3,5-bis(4-methoxyphenyl)-4,5-dihydrooxazole structure
|
Common Name | 3,5-bis(4-methoxyphenyl)-4,5-dihydrooxazole | ||
|---|---|---|---|---|
| CAS Number | 20821-99-2 | Molecular Weight | 283.32200 | |
| Density | 1.16g/cm3 | Boiling Point | 422.5ºC at 760 mmHg | |
| Molecular Formula | C17H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.7ºC | |
| Name | 3,5-bis(4-methoxyphenyl)-4,5-dihydro-1,2-oxazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 422.5ºC at 760 mmHg |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.32200 |
| Flash Point | 168.7ºC |
| Exact Mass | 283.12100 |
| PSA | 40.05000 |
| LogP | 3.00510 |
| Vapour Pressure | 5.88E-07mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | DIMSUUHVHWLUDT-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2=NOC(c3ccc(OC)cc3)C2)cc1 |
|
~87%
3,5-bis(4-metho... CAS#:20821-99-2 |
| Literature: Ichinose, Nobuyuki; Mizuno, Kazuhiko; Tamai, Toshiyuki; Otsuji, Yoshio Chemistry Letters, 1988 , p. 233 - 236 |
|
~93%
3,5-bis(4-metho... CAS#:20821-99-2 |
| Literature: Mizuno, Kazuhiko; Ichinose, Nobuyuki; Tamai, Toshiyuki; Otsuji, Yoshio Journal of Organic Chemistry, 1992 , vol. 57, # 17 p. 4669 - 4675 |
|
~42%
3,5-bis(4-metho... CAS#:20821-99-2
Detail
|
| Literature: Saginova; Grigor'ev Chemistry of Heterocyclic Compounds, 1999 , vol. 35, # 2 p. 246 - 247 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 3,5-bis(4-methoxyphenyl)-2-isoxazoline |
| 3,5-bis-(4-methoxy-phenyl)-4,5-dihydro-isoxazole |
| 3,5-Bis(p-methoxyphenyl)-4,5-dihydroisoxazole |