(E)-6-Styryl-2H-pyrazino[2,3-B][1,4]thiazin-3(4H)-one structure
|
Common Name | (E)-6-Styryl-2H-pyrazino[2,3-B][1,4]thiazin-3(4H)-one | ||
|---|---|---|---|---|
| CAS Number | 2083653-84-1 | Molecular Weight | 269.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (E)-6-Styryl-2H-pyrazino[2,3-B][1,4]thiazin-3(4H)-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H11N3OS |
|---|---|
| Molecular Weight | 269.32 |
| InChIKey | KNNQBMSRFSCWGM-VOTSOKGWSA-N |
| SMILES | O=C1CSc2ncc(C=Cc3ccccc3)nc2N1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2083653-84-1? |
| A: Chinese name of 2083653-84-1 is 2083653-84-1. |
| Q: What is the SMILES notation of (E)-6-Styryl-2H-pyrazino[2,3-B][1,4]thiazin-3(4H)-one? |
| A: SMILES notation of (E)-6-Styryl-2H-pyrazino[2,3-B][1,4]thiazin-3(4H)-one is O=C1CSc2ncc(C=Cc3ccccc3)nc2N1. |
| Q: What is the molecular formula of (E)-6-Styryl-2H-pyrazino[2,3-B][1,4]thiazin-3(4H)-one? |
| A: Molecular formula of (E)-6-Styryl-2H-pyrazino[2,3-B][1,4]thiazin-3(4H)-one is C14H11N3OS. |
| Q: What is the English name of (E)-6-Styryl-2H-pyrazino[2,3-B][1,4]thiazin-3(4H)-one? |
| A: The English name of (E)-6-Styryl-2H-pyrazino[2,3-B][1,4]thiazin-3(4H)-one is (E)-6-Styryl-2H-pyrazino[2,3-B][1,4]thiazin-3(4H)-one. |
| Q: What is the InChIKey of (E)-6-Styryl-2H-pyrazino[2,3-B][1,4]thiazin-3(4H)-one? |
| A: InChIKey of (E)-6-Styryl-2H-pyrazino[2,3-B][1,4]thiazin-3(4H)-one is KNNQBMSRFSCWGM-VOTSOKGWSA-N. |
| Q: What is the molecular weight of (E)-6-Styryl-2H-pyrazino[2,3-B][1,4]thiazin-3(4H)-one? |
| A: Molecular weight of (E)-6-Styryl-2H-pyrazino[2,3-B][1,4]thiazin-3(4H)-one is 269.32. |
| Q: What is the CAS number of (E)-6-Styryl-2H-pyrazino[2,3-B][1,4]thiazin-3(4H)-one? |
| A: CAS number of (E)-6-Styryl-2H-pyrazino[2,3-B][1,4]thiazin-3(4H)-one is 2083653-84-1. |