tert-Butyl (3-(3-bromo-5-(trifluoromethyl)phenoxy)propyl)carbamate structure
|
Common Name | tert-Butyl (3-(3-bromo-5-(trifluoromethyl)phenoxy)propyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 2084048-19-9 | Molecular Weight | 398.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H19BrF3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-Butyl (3-(3-bromo-5-(trifluoromethyl)phenoxy)propyl)carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H19BrF3NO3 |
|---|---|
| Molecular Weight | 398.21 |
| InChIKey | VXJPZKJSTNYXDP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCOc1cc(Br)cc(C(F)(F)F)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2084048-19-9? |
| A: Chinese name of 2084048-19-9 is 2084048-19-9. |
| Q: What is the CAS number of tert-Butyl (3-(3-bromo-5-(trifluoromethyl)phenoxy)propyl)carbamate? |
| A: CAS number of tert-Butyl (3-(3-bromo-5-(trifluoromethyl)phenoxy)propyl)carbamate is 2084048-19-9. |
| Q: What is the SMILES notation of tert-Butyl (3-(3-bromo-5-(trifluoromethyl)phenoxy)propyl)carbamate? |
| A: SMILES notation of tert-Butyl (3-(3-bromo-5-(trifluoromethyl)phenoxy)propyl)carbamate is CC(C)(C)OC(=O)NCCCOc1cc(Br)cc(C(F)(F)F)c1. |
| Q: What is the InChIKey of tert-Butyl (3-(3-bromo-5-(trifluoromethyl)phenoxy)propyl)carbamate? |
| A: InChIKey of tert-Butyl (3-(3-bromo-5-(trifluoromethyl)phenoxy)propyl)carbamate is VXJPZKJSTNYXDP-UHFFFAOYSA-N. |
| Q: What is the molecular formula of tert-Butyl (3-(3-bromo-5-(trifluoromethyl)phenoxy)propyl)carbamate? |
| A: Molecular formula of tert-Butyl (3-(3-bromo-5-(trifluoromethyl)phenoxy)propyl)carbamate is C15H19BrF3NO3. |
| Q: What is the molecular weight of tert-Butyl (3-(3-bromo-5-(trifluoromethyl)phenoxy)propyl)carbamate? |
| A: Molecular weight of tert-Butyl (3-(3-bromo-5-(trifluoromethyl)phenoxy)propyl)carbamate is 398.21. |
| Q: What is the English name of tert-Butyl (3-(3-bromo-5-(trifluoromethyl)phenoxy)propyl)carbamate? |
| A: The English name of tert-Butyl (3-(3-bromo-5-(trifluoromethyl)phenoxy)propyl)carbamate is tert-Butyl (3-(3-bromo-5-(trifluoromethyl)phenoxy)propyl)carbamate. |