5,6-dichloro-3-(3-methoxypropyl)-1,3-benzoxazol-2-one structure
|
Common Name | 5,6-dichloro-3-(3-methoxypropyl)-1,3-benzoxazol-2-one | ||
|---|---|---|---|---|
| CAS Number | 20844-83-1 | Molecular Weight | 276.11600 | |
| Density | 1.394g/cm3 | Boiling Point | 393.2ºC at 760 mmHg | |
| Molecular Formula | C11H11Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.6ºC | |
| Name | 5,6-dichloro-3-(3-methoxypropyl)-1,3-benzoxazol-2-one |
|---|
| Density | 1.394g/cm3 |
|---|---|
| Boiling Point | 393.2ºC at 760 mmHg |
| Molecular Formula | C11H11Cl2NO3 |
| Molecular Weight | 276.11600 |
| Flash Point | 191.6ºC |
| Exact Mass | 275.01200 |
| PSA | 44.37000 |
| LogP | 2.93780 |
| Vapour Pressure | 2.16E-06mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | VPPSCPRHYMFSKA-UHFFFAOYSA-N |
| SMILES | COCCCn1c(=O)oc2cc(Cl)c(Cl)cc21 |
|
~%
5,6-dichloro-3-... CAS#:20844-83-1 |
| Literature: Sam; Valentine; Richmond Journal of pharmaceutical sciences, 1968 , vol. 57, # 10 p. 1763 - 1768 |
|
~%
5,6-dichloro-3-... CAS#:20844-83-1 |
| Literature: Sam; Valentine; Richmond Journal of pharmaceutical sciences, 1968 , vol. 57, # 10 p. 1763 - 1768 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |