1,3-Dithiol-1-ium, 4-hydroxy-2,5-diphenyl-, hydroxide, inner salt structure
|
Common Name | 1,3-Dithiol-1-ium, 4-hydroxy-2,5-diphenyl-, hydroxide, inner salt | ||
|---|---|---|---|---|
| CAS Number | 20850-89-9 | Molecular Weight | 270.36900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,5-diphenyl-1,3-dithiol-3-ium-4-olate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H10OS2 |
|---|---|
| Molecular Weight | 270.36900 |
| Exact Mass | 270.01700 |
| PSA | 79.54000 |
| LogP | 5.56850 |
| InChIKey | FVWLMVCCZWCWBY-UHFFFAOYSA-N |
| SMILES | O=C1SC(c2ccccc2)=S=C1c1ccccc1 |
|
~26%
1,3-Dithiol-1-i... CAS#:20850-89-9 |
| Literature: Tono, Masaki; Aoto, Hiroshi; Matsudaira, Yorimasa; Sugiyama, Tom; Kajitani, Masatsugu; Akiyama, Takeo; Sugimori, Akira Tetrahedron Letters, 1991 , vol. 32, # 32 p. 4023 - 4026 |
| Precursor 0 | |
|---|---|
| DownStream 10 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 2,5-diphenyl-1,3-dithiol-4-one |
| 4-oxo-2,5-diphenyl-[1,3]dithiolan-2-ylium betaine |
| 2,5-diphenyl-[1,3]dithiolylium-4-olate |
| 5-oxo-2,4-diphenyl-[1,3]dithiolan-2-ylium-4-ide |
| 2,5-diphenyldithiolone |
| 1,4-hydroxy-2,5-diphenyl-,hydroxide,inner salt |
| 2,5-diphenyl-1,3-dithiolium-4-olate |