Protoescigenin structure
|
Common Name | Protoescigenin | ||
|---|---|---|---|---|
| CAS Number | 20853-07-0 | Molecular Weight | 506.714 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 634.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C30H50O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.0±26.1 °C | |
Use of ProtoescigeninProtoescigenin is the main aglycone of horse chestnut saponin mixture known as escin. Protoescigenin is selected as substrate for exploratory chemistry towards selective protection, followed by propargyl ether formation and subsequent condensation with azido-monosaccharides, to obtain novel triazole linked conjugates of the triterpene[1]. |
| Name | protoaescigenin |
|---|---|
| Synonym | More Synonyms |
| Description | Protoescigenin is the main aglycone of horse chestnut saponin mixture known as escin. Protoescigenin is selected as substrate for exploratory chemistry towards selective protection, followed by propargyl ether formation and subsequent condensation with azido-monosaccharides, to obtain novel triazole linked conjugates of the triterpene[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 634.5±55.0 °C at 760 mmHg |
| Molecular Formula | C30H50O6 |
| Molecular Weight | 506.714 |
| Flash Point | 262.0±26.1 °C |
| Exact Mass | 506.360748 |
| PSA | 121.38000 |
| LogP | 3.98 |
| Vapour Pressure | 0.0±4.2 mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | VKJLHZZPVLQJKG-JAGYOTNFSA-N |
| SMILES | CC1(C)CC2C3=CCC4C5(C)CCC(O)C(C)(CO)C5CCC4(C)C3(C)CC(O)C2(CO)C(O)C1O |
| Protoaescigenin |
| protoescigenin |
| Olean-12-ene-3β,16α,21β,22α,24,28-hexol |
| Olean-12-ene-3,16,21,22,24,28-hexol, (3β,16α,21β,22α)- |
| protoescigenine (reference grade) |
| (3β,16α,21β,22α)-Olean-12-ene-3,16,21,22,24,28-hexol |