2-methylthio-N-6-isopentenyladenosine structure
|
Common Name | 2-methylthio-N-6-isopentenyladenosine | ||
|---|---|---|---|---|
| CAS Number | 20859-00-1 | Molecular Weight | 381.45 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H23N5O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2-methylthio-N-6-isopentenyladenosine2-Methylthio isopentenyladenosine is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
| Name | 2-methylthio-N6-(Δ2-isopentenyl)adenosine |
|---|---|
| Synonym | More Synonyms |
| Description | 2-Methylthio isopentenyladenosine is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C16H23N5O4S |
|---|---|
| Molecular Weight | 381.45 |
| Exact Mass | 381.14700 |
| PSA | 150.85000 |
| LogP | 0.61080 |
| Vapour Pressure | 1.24E-21mmHg at 25°C |
| InChIKey | VZQXUWKZDSEQRR-SDBHATRESA-N |
| SMILES | CSc1nc(NCC=C(C)C)c2ncn(C3OC(CO)C(O)C3O)c2n1 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 2-methylthio-N(6)-(Delta(2)-isopentenyl)adenosine |
| Nucleoside |
| 2-methylthio-iPR |
| 2-methylthio-N6-isopentenyladenosine |