(4-Acetoxyphenoxy)acetic acid
Modify Date: 2025-09-16 10:38:28
(4-Acetoxyphenoxy)acetic acid structure
|
Common Name | (4-Acetoxyphenoxy)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 20872-29-1 | Molecular Weight | 210.183 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 365.5±22.0 °C at 760 mmHg | |
| Molecular Formula | C10H10O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.6±15.8 °C | |
| Name | 2-(4-acetyloxyphenoxy)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 365.5±22.0 °C at 760 mmHg |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.183 |
| Flash Point | 145.6±15.8 °C |
| Exact Mass | 210.052826 |
| PSA | 72.83000 |
| LogP | 0.69 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.535 |
| InChIKey | GEHROUVMFOQBMR-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccc(OCC(=O)O)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Acetoxyphenoxy-acetic acid |
| 2-(4-acetoxyphenoxy)acetic acid |
| Acetic acid, 2-[4-(acetyloxy)phenoxy]- |
| 4-Acetoxyphrnoxyaceticacid |
| (4-Acetoxyphenoxy)acetic acid |
| p-acetoxyphenoxyacetic acid |