Oseltamivir acid methyl ester structure
|
Common Name | Oseltamivir acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 208720-71-2 | Molecular Weight | 298.37800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H26N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Oseltamivir acid methyl esterOseltamivir acid methyl ester is a precursor form of the neuraminidase inhibitor and antiviral oseltamivir acid. Oseltamivir acid methyl ester is converted to oseltamivir acid by carboxylesterase 1 (CES1) [1]. |
| Name | Oseltamivir Acid Methyl Ester |
|---|---|
| Synonym | More Synonyms |
| Description | Oseltamivir acid methyl ester is a precursor form of the neuraminidase inhibitor and antiviral oseltamivir acid. Oseltamivir acid methyl ester is converted to oseltamivir acid by carboxylesterase 1 (CES1) [1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C15H26N2O4 |
|---|---|
| Molecular Weight | 298.37800 |
| Exact Mass | 298.18900 |
| PSA | 94.14000 |
| LogP | 2.43590 |
| InChIKey | HQFJHRGEFIDLDI-BFHYXJOUSA-N |
| SMILES | CCC(CC)OC1C=C(C(=O)OC)CC(N)C1NC(C)=O |
| Methyl 4-acetamido-5-amino-3-(3-pentanyloxy)-1-cyclohexene-1-carb oxylate |