4-Amino-1-methyl-2lambda6-thia-1-azaspiro[4.4]non-3-ene-2,2-dione
Modify Date: 2026-07-17 18:17:35
![4-Amino-1-methyl-2lambda6-thia-1-azaspiro[4.4]non-3-ene-2,2-dione Structure](https://www.chemsrc.com/extcaspic/237/2088353-66-4.png)
4-Amino-1-methyl-2lambda6-thia-1-azaspiro[4.4]non-3-ene-2,2-dione structure
|
Common Name | 4-Amino-1-methyl-2lambda6-thia-1-azaspiro[4.4]non-3-ene-2,2-dione | ||
|---|---|---|---|---|
| CAS Number | 2088353-66-4 | Molecular Weight | 202.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H14N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Amino-1-methyl-2lambda6-thia-1-azaspiro[4.4]non-3-ene-2,2-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H14N2O2S |
|---|---|
| Molecular Weight | 202.28 |
| InChIKey | DHELMMVHSJHHJZ-UHFFFAOYSA-N |
| SMILES | CN1C2(CCCC2)C(N)=CS1(=O)=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-Amino-1-methyl-2lambda6-thia-1-azaspiro[4.4]non-3-ene-2,2-dione? |
| A: Molecular formula of 4-Amino-1-methyl-2lambda6-thia-1-azaspiro[4.4]non-3-ene-2,2-dione is C8H14N2O2S. |
| Q: What is the English name of 4-Amino-1-methyl-2lambda6-thia-1-azaspiro[4.4]non-3-ene-2,2-dione? |
| A: The English name of 4-Amino-1-methyl-2lambda6-thia-1-azaspiro[4.4]non-3-ene-2,2-dione is 4-Amino-1-methyl-2lambda6-thia-1-azaspiro[4.4]non-3-ene-2,2-dione. |
| Q: What is the Chinese name of 2088353-66-4? |
| A: Chinese name of 2088353-66-4 is 2088353-66-4. |
| Q: What is the molecular weight of 4-Amino-1-methyl-2lambda6-thia-1-azaspiro[4.4]non-3-ene-2,2-dione? |
| A: Molecular weight of 4-Amino-1-methyl-2lambda6-thia-1-azaspiro[4.4]non-3-ene-2,2-dione is 202.28. |
| Q: What is the CAS number of 4-Amino-1-methyl-2lambda6-thia-1-azaspiro[4.4]non-3-ene-2,2-dione? |
| A: CAS number of 4-Amino-1-methyl-2lambda6-thia-1-azaspiro[4.4]non-3-ene-2,2-dione is 2088353-66-4. |
| Q: What is the SMILES notation of 4-Amino-1-methyl-2lambda6-thia-1-azaspiro[4.4]non-3-ene-2,2-dione? |
| A: SMILES notation of 4-Amino-1-methyl-2lambda6-thia-1-azaspiro[4.4]non-3-ene-2,2-dione is CN1C2(CCCC2)C(N)=CS1(=O)=O. |
| Q: What is the InChIKey of 4-Amino-1-methyl-2lambda6-thia-1-azaspiro[4.4]non-3-ene-2,2-dione? |
| A: InChIKey of 4-Amino-1-methyl-2lambda6-thia-1-azaspiro[4.4]non-3-ene-2,2-dione is DHELMMVHSJHHJZ-UHFFFAOYSA-N. |