4',5-Dichloro-4-methyl-[1,1'-biphenyl]-2-OL
Modify Date: 2025-08-31 16:15:54
![4',5-Dichloro-4-methyl-[1,1'-biphenyl]-2-OL Structure](https://www.chemsrc.com/extcaspic/384/2088367-62-6.png)
4',5-Dichloro-4-methyl-[1,1'-biphenyl]-2-OL structure
|
Common Name | 4',5-Dichloro-4-methyl-[1,1'-biphenyl]-2-OL | ||
|---|---|---|---|---|
| CAS Number | 2088367-62-6 | Molecular Weight | 253.12 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4',5-Dichloro-4-methyl-[1,1'-biphenyl]-2-OL |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H10Cl2O |
|---|---|
| Molecular Weight | 253.12 |
| InChIKey | WSDUBROPQIZMOM-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)c(-c2ccc(Cl)cc2)cc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4',5-Dichloro-4-methyl-[1,1'-biphenyl]-2-OL? |
| A: InChIKey of 4',5-Dichloro-4-methyl-[1,1'-biphenyl]-2-OL is WSDUBROPQIZMOM-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4',5-Dichloro-4-methyl-[1,1'-biphenyl]-2-OL? |
| A: Molecular weight of 4',5-Dichloro-4-methyl-[1,1'-biphenyl]-2-OL is 253.12. |
| Q: What is the Chinese name of 2088367-62-6? |
| A: Chinese name of 2088367-62-6 is 2088367-62-6. |
| Q: What is the molecular formula of 4',5-Dichloro-4-methyl-[1,1'-biphenyl]-2-OL? |
| A: Molecular formula of 4',5-Dichloro-4-methyl-[1,1'-biphenyl]-2-OL is C13H10Cl2O. |
| Q: What is the CAS number of 4',5-Dichloro-4-methyl-[1,1'-biphenyl]-2-OL? |
| A: CAS number of 4',5-Dichloro-4-methyl-[1,1'-biphenyl]-2-OL is 2088367-62-6. |
| Q: What is the English name of 4',5-Dichloro-4-methyl-[1,1'-biphenyl]-2-OL? |
| A: The English name of 4',5-Dichloro-4-methyl-[1,1'-biphenyl]-2-OL is 4',5-Dichloro-4-methyl-[1,1'-biphenyl]-2-OL. |
| Q: What is the SMILES notation of 4',5-Dichloro-4-methyl-[1,1'-biphenyl]-2-OL? |
| A: SMILES notation of 4',5-Dichloro-4-methyl-[1,1'-biphenyl]-2-OL is Cc1cc(O)c(-c2ccc(Cl)cc2)cc1Cl. |