5-Chloro-4-methyl-2'-(methylsulfonyl)[1,1'-biphenyl]-2-ol
Modify Date: 2025-09-02 10:12:50
![5-Chloro-4-methyl-2'-(methylsulfonyl)[1,1'-biphenyl]-2-ol Structure](https://www.chemsrc.com/extcaspic/270/2088367-65-9.png)
5-Chloro-4-methyl-2'-(methylsulfonyl)[1,1'-biphenyl]-2-ol structure
|
Common Name | 5-Chloro-4-methyl-2'-(methylsulfonyl)[1,1'-biphenyl]-2-ol | ||
|---|---|---|---|---|
| CAS Number | 2088367-65-9 | Molecular Weight | 296.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13ClO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Chloro-4-methyl-2'-(methylsulfonyl)[1,1'-biphenyl]-2-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H13ClO3S |
|---|---|
| Molecular Weight | 296.8 |
| InChIKey | JTPWQRBZQDDFLC-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)c(-c2ccccc2S(C)(=O)=O)cc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 5-Chloro-4-methyl-2'-(methylsulfonyl)[1,1'-biphenyl]-2-ol? |
| A: Molecular weight of 5-Chloro-4-methyl-2'-(methylsulfonyl)[1,1'-biphenyl]-2-ol is 296.8. |
| Q: What is the English name of 5-Chloro-4-methyl-2'-(methylsulfonyl)[1,1'-biphenyl]-2-ol? |
| A: The English name of 5-Chloro-4-methyl-2'-(methylsulfonyl)[1,1'-biphenyl]-2-ol is 5-Chloro-4-methyl-2'-(methylsulfonyl)[1,1'-biphenyl]-2-ol. |
| Q: What is the SMILES notation of 5-Chloro-4-methyl-2'-(methylsulfonyl)[1,1'-biphenyl]-2-ol? |
| A: SMILES notation of 5-Chloro-4-methyl-2'-(methylsulfonyl)[1,1'-biphenyl]-2-ol is Cc1cc(O)c(-c2ccccc2S(C)(=O)=O)cc1Cl. |
| Q: What is the InChIKey of 5-Chloro-4-methyl-2'-(methylsulfonyl)[1,1'-biphenyl]-2-ol? |
| A: InChIKey of 5-Chloro-4-methyl-2'-(methylsulfonyl)[1,1'-biphenyl]-2-ol is JTPWQRBZQDDFLC-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2088367-65-9? |
| A: Chinese name of 2088367-65-9 is 2088367-65-9. |
| Q: What is the molecular formula of 5-Chloro-4-methyl-2'-(methylsulfonyl)[1,1'-biphenyl]-2-ol? |
| A: Molecular formula of 5-Chloro-4-methyl-2'-(methylsulfonyl)[1,1'-biphenyl]-2-ol is C14H13ClO3S. |
| Q: What is the CAS number of 5-Chloro-4-methyl-2'-(methylsulfonyl)[1,1'-biphenyl]-2-ol? |
| A: CAS number of 5-Chloro-4-methyl-2'-(methylsulfonyl)[1,1'-biphenyl]-2-ol is 2088367-65-9. |