5'-Chloro-2'-hydroxy-N-(2-methoxyethyl)-4'-methyl[1,1'-biphenyl]-3-carboxamide
Modify Date: 2026-07-09 21:10:04
![5'-Chloro-2'-hydroxy-N-(2-methoxyethyl)-4'-methyl[1,1'-biphenyl]-3-carboxamide Structure](https://www.chemsrc.com/extcaspic/091/2088367-74-0.png)
5'-Chloro-2'-hydroxy-N-(2-methoxyethyl)-4'-methyl[1,1'-biphenyl]-3-carboxamide structure
|
Common Name | 5'-Chloro-2'-hydroxy-N-(2-methoxyethyl)-4'-methyl[1,1'-biphenyl]-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 2088367-74-0 | Molecular Weight | 319.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5'-Chloro-2'-hydroxy-N-(2-methoxyethyl)-4'-methyl[1,1'-biphenyl]-3-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H18ClNO3 |
|---|---|
| Molecular Weight | 319.8 |
| InChIKey | BJOKZDIWSVIHAK-UHFFFAOYSA-N |
| SMILES | COCCNC(=O)c1cccc(-c2cc(Cl)c(C)cc2O)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 5'-Chloro-2'-hydroxy-N-(2-methoxyethyl)-4'-methyl[1,1'-biphenyl]-3-carboxamide? |
| A: Molecular weight of 5'-Chloro-2'-hydroxy-N-(2-methoxyethyl)-4'-methyl[1,1'-biphenyl]-3-carboxamide is 319.8. |
| Q: What is the Chinese name of 2088367-74-0? |
| A: Chinese name of 2088367-74-0 is 2088367-74-0. |
| Q: What is the English name of 5'-Chloro-2'-hydroxy-N-(2-methoxyethyl)-4'-methyl[1,1'-biphenyl]-3-carboxamide? |
| A: The English name of 5'-Chloro-2'-hydroxy-N-(2-methoxyethyl)-4'-methyl[1,1'-biphenyl]-3-carboxamide is 5'-Chloro-2'-hydroxy-N-(2-methoxyethyl)-4'-methyl[1,1'-biphenyl]-3-carboxamide. |
| Q: What is the molecular formula of 5'-Chloro-2'-hydroxy-N-(2-methoxyethyl)-4'-methyl[1,1'-biphenyl]-3-carboxamide? |
| A: Molecular formula of 5'-Chloro-2'-hydroxy-N-(2-methoxyethyl)-4'-methyl[1,1'-biphenyl]-3-carboxamide is C17H18ClNO3. |
| Q: What is the InChIKey of 5'-Chloro-2'-hydroxy-N-(2-methoxyethyl)-4'-methyl[1,1'-biphenyl]-3-carboxamide? |
| A: InChIKey of 5'-Chloro-2'-hydroxy-N-(2-methoxyethyl)-4'-methyl[1,1'-biphenyl]-3-carboxamide is BJOKZDIWSVIHAK-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 5'-Chloro-2'-hydroxy-N-(2-methoxyethyl)-4'-methyl[1,1'-biphenyl]-3-carboxamide? |
| A: SMILES notation of 5'-Chloro-2'-hydroxy-N-(2-methoxyethyl)-4'-methyl[1,1'-biphenyl]-3-carboxamide is COCCNC(=O)c1cccc(-c2cc(Cl)c(C)cc2O)c1. |
| Q: What is the CAS number of 5'-Chloro-2'-hydroxy-N-(2-methoxyethyl)-4'-methyl[1,1'-biphenyl]-3-carboxamide? |
| A: CAS number of 5'-Chloro-2'-hydroxy-N-(2-methoxyethyl)-4'-methyl[1,1'-biphenyl]-3-carboxamide is 2088367-74-0. |