Methyl 5'-chloro-2'-hydroxy-4',6-dimethyl[1,1'-biphenyl]-3-carboxylate structure
|
Common Name | Methyl 5'-chloro-2'-hydroxy-4',6-dimethyl[1,1'-biphenyl]-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2088367-85-3 | Molecular Weight | 290.74 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 5'-chloro-2'-hydroxy-4',6-dimethyl[1,1'-biphenyl]-3-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H15ClO3 |
|---|---|
| Molecular Weight | 290.74 |
| InChIKey | SZMIHFURMPMUDN-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C)c(-c2cc(Cl)c(C)cc2O)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Methyl 5'-chloro-2'-hydroxy-4',6-dimethyl[1,1'-biphenyl]-3-carboxylate? |
| A: CAS number of Methyl 5'-chloro-2'-hydroxy-4',6-dimethyl[1,1'-biphenyl]-3-carboxylate is 2088367-85-3. |
| Q: What is the molecular weight of Methyl 5'-chloro-2'-hydroxy-4',6-dimethyl[1,1'-biphenyl]-3-carboxylate? |
| A: Molecular weight of Methyl 5'-chloro-2'-hydroxy-4',6-dimethyl[1,1'-biphenyl]-3-carboxylate is 290.74. |
| Q: What is the Chinese name of 2088367-85-3? |
| A: Chinese name of 2088367-85-3 is 2088367-85-3. |
| Q: What is the SMILES notation of Methyl 5'-chloro-2'-hydroxy-4',6-dimethyl[1,1'-biphenyl]-3-carboxylate? |
| A: SMILES notation of Methyl 5'-chloro-2'-hydroxy-4',6-dimethyl[1,1'-biphenyl]-3-carboxylate is COC(=O)c1ccc(C)c(-c2cc(Cl)c(C)cc2O)c1. |
| Q: What is the InChIKey of Methyl 5'-chloro-2'-hydroxy-4',6-dimethyl[1,1'-biphenyl]-3-carboxylate? |
| A: InChIKey of Methyl 5'-chloro-2'-hydroxy-4',6-dimethyl[1,1'-biphenyl]-3-carboxylate is SZMIHFURMPMUDN-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Methyl 5'-chloro-2'-hydroxy-4',6-dimethyl[1,1'-biphenyl]-3-carboxylate? |
| A: Molecular formula of Methyl 5'-chloro-2'-hydroxy-4',6-dimethyl[1,1'-biphenyl]-3-carboxylate is C16H15ClO3. |
| Q: What is the English name of Methyl 5'-chloro-2'-hydroxy-4',6-dimethyl[1,1'-biphenyl]-3-carboxylate? |
| A: The English name of Methyl 5'-chloro-2'-hydroxy-4',6-dimethyl[1,1'-biphenyl]-3-carboxylate is Methyl 5'-chloro-2'-hydroxy-4',6-dimethyl[1,1'-biphenyl]-3-carboxylate. |