2,4-Dichloro-5-fluoro-N,N-bis(isopropyl)benzamide
Modify Date: 2026-07-01 21:54:09
2,4-Dichloro-5-fluoro-N,N-bis(isopropyl)benzamide structure
|
Common Name | 2,4-Dichloro-5-fluoro-N,N-bis(isopropyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 2088945-68-8 | Molecular Weight | 292.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16Cl2FNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-Dichloro-5-fluoro-N,N-bis(isopropyl)benzamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16Cl2FNO |
|---|---|
| Molecular Weight | 292.17 |
| InChIKey | MSNQPXWERVHHER-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(=O)c1cc(F)c(Cl)cc1Cl)C(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2,4-Dichloro-5-fluoro-N,N-bis(isopropyl)benzamide? |
| A: SMILES notation of 2,4-Dichloro-5-fluoro-N,N-bis(isopropyl)benzamide is CC(C)N(C(=O)c1cc(F)c(Cl)cc1Cl)C(C)C. |
| Q: What is the molecular weight of 2,4-Dichloro-5-fluoro-N,N-bis(isopropyl)benzamide? |
| A: Molecular weight of 2,4-Dichloro-5-fluoro-N,N-bis(isopropyl)benzamide is 292.17. |
| Q: What is the CAS number of 2,4-Dichloro-5-fluoro-N,N-bis(isopropyl)benzamide? |
| A: CAS number of 2,4-Dichloro-5-fluoro-N,N-bis(isopropyl)benzamide is 2088945-68-8. |
| Q: What is the molecular formula of 2,4-Dichloro-5-fluoro-N,N-bis(isopropyl)benzamide? |
| A: Molecular formula of 2,4-Dichloro-5-fluoro-N,N-bis(isopropyl)benzamide is C13H16Cl2FNO. |
| Q: What is the English name of 2,4-Dichloro-5-fluoro-N,N-bis(isopropyl)benzamide? |
| A: The English name of 2,4-Dichloro-5-fluoro-N,N-bis(isopropyl)benzamide is 2,4-Dichloro-5-fluoro-N,N-bis(isopropyl)benzamide. |
| Q: What is the InChIKey of 2,4-Dichloro-5-fluoro-N,N-bis(isopropyl)benzamide? |
| A: InChIKey of 2,4-Dichloro-5-fluoro-N,N-bis(isopropyl)benzamide is MSNQPXWERVHHER-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2088945-68-8? |
| A: Chinese name of 2088945-68-8 is 2088945-68-8. |