allopregnanetrione structure
|
Common Name | allopregnanetrione | ||
|---|---|---|---|---|
| CAS Number | 2089-06-7 | Molecular Weight | 330.46100 | |
| Density | 1.107g/cm3 | Boiling Point | 466.5ºC at 760 mmHg | |
| Molecular Formula | C21H30O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 199.2ºC | |
| Name | (5S,8S,9S,10S,13S,14S,17S)-17-acetyl-10,13-dimethyl-2,4,5,6,7,8,9,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,11-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.107g/cm3 |
|---|---|
| Boiling Point | 466.5ºC at 760 mmHg |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.46100 |
| Flash Point | 199.2ºC |
| Exact Mass | 330.21900 |
| PSA | 51.21000 |
| LogP | 3.98240 |
| Vapour Pressure | 7.04E-09mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | AHRWWYGWQKBKBF-MUGXHADPSA-N |
| SMILES | CC(=O)C1CCC2C3CCC4CC(=O)CCC4(C)C3C(=O)CC12C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| 5alpha-Pregnane-3,11,20-trione |
| BB_NC-0585 |
| Allopregnanetrione |
| P3421_FLUKA |