3-(2-Methoxyphenyl)-2-phenylacrylic acid structure
|
Common Name | 3-(2-Methoxyphenyl)-2-phenylacrylic acid | ||
|---|---|---|---|---|
| CAS Number | 20890-72-6 | Molecular Weight | 254.28100 | |
| Density | 1.204g/cm3 | Boiling Point | 374.2ºC at 760 mmHg | |
| Molecular Formula | C16H14O3 | Melting Point | 187-189ºC | |
| MSDS | N/A | Flash Point | 135.9ºC | |
| Name | 3-(2-Methoxyphenyl)-2-phenylacrylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.204g/cm3 |
|---|---|
| Boiling Point | 374.2ºC at 760 mmHg |
| Melting Point | 187-189ºC |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28100 |
| Flash Point | 135.9ºC |
| Exact Mass | 254.09400 |
| PSA | 46.53000 |
| LogP | 3.32040 |
| Vapour Pressure | 2.91E-06mmHg at 25°C |
| Index of Refraction | 1.63 |
| InChIKey | SJSYJHLLBBSLIH-KAMYIIQDSA-N |
| SMILES | COc1ccccc1C=C(C(=O)O)c1ccccc1 |
| HS Code | 2918990090 |
|---|
|
~49%
3-(2-Methoxyphe... CAS#:20890-72-6 |
| Literature: Felfoeldi, Karoly; Sutyinszky, Maria; Nagy, Nora; Palinko, Istvan Synthetic Communications, 2000 , vol. 30, # 9 p. 1543 - 1553 |
|
~%
3-(2-Methoxyphe... CAS#:20890-72-6
3-(2-Methoxyphe... CAS#:20890-72-6 |
| Literature: Bulletin of the Chemical Society of Japan, , vol. 53, # 1 p. 179 - 184 |
|
~%
3-(2-Methoxyphe... CAS#:20890-72-6 |
| Literature: Collection of Czechoslovak Chemical Communications, , vol. 64, # 1 p. 1594 - 1600 |
|
~%
3-(2-Methoxyphe... CAS#:20890-72-6 |
| Literature: Journal of the Chemical Society, , p. 3445,3448 |
|
~%
3-(2-Methoxyphe... CAS#:20890-72-6 |
| Literature: Journal of the Chemical Society, , p. 3445,3448 |
| Precursor 5 | |
|---|---|
| DownStream 4 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3t-(2-methoxy-phenyl)-2-phenyl-acrylic acid |
| 3t-(2-Methoxy-phenyl)-2-phenyl-acrylsaeure |
| E-3-(o-methoxyphenyl)-2-phenyl propenoic acid |
| (E)-3-(2-METHOXYPHENYL)-2-PHENYL-2-PROPENOIC ACID |
| 2-Phenyl-3t-(2-methoxy-phenyl)-acrylsaeure |
| E-2-phenyl-3-(2'-methoxyphenyl)propenoic acid |