N-(2-aminoethyl)-2,4-dichloro-N-{4-[(4-chlorophenyl)methoxy]phenyl}benzamide structure
|
Common Name | N-(2-aminoethyl)-2,4-dichloro-N-{4-[(4-chlorophenyl)methoxy]phenyl}benzamide | ||
|---|---|---|---|---|
| CAS Number | 2089056-76-6 | Molecular Weight | 449.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H19Cl3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(2-aminoethyl)-2,4-dichloro-N-{4-[(4-chlorophenyl)methoxy]phenyl}benzamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H19Cl3N2O2 |
|---|---|
| Molecular Weight | 449.8 |
| InChIKey | KKZDZTJFDLFERF-UHFFFAOYSA-N |
| SMILES | NCCN(C(=O)c1ccc(Cl)cc1Cl)c1ccc(OCc2ccc(Cl)cc2)cc1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Antitrypanosomal activity against Trypanosoma brucei brucei 427 bloodstream forms aft...
Source: ChEMBL
Target: Trypanosoma brucei brucei
External Id: CHEMBL4369188
|
|
Name: PMM CC50 (uM) Cytotoxicity
Source: ChEMBL
Target: NON-PROTEIN TARGET
External Id: CHEMBL3832843
|
|
Name: Antibacterial activity against Staphylococcus aureus MRSA ATCC 43300 (CO-ADD:GP_020);...
Source: ChEMBL
Target: Staphylococcus aureus
External Id: CHEMBL4296184
|
|
Name: Antibacterial activity against Klebsiella pneumoniae MDR ATCC 70063 (CO-ADD:GN_003); ...
Source: ChEMBL
Target: Klebsiella pneumoniae
External Id: CHEMBL4296186
|
|
Name: AntiTrypanosoma cruzi activity IC50 (uM)
Source: ChEMBL
Target: Trypanosoma cruzi
External Id: CHEMBL3832785
|
|
Name: Antibacterial activity against Escherichia coli ATCC 25922 (CO-ADD:GN_001); MIC in CA...
Source: ChEMBL
Target: Escherichia coli
External Id: CHEMBL4296185
|
|
Name: AntiTrypanosoma brucei activity T. b. brucei IC50 (uM)
Source: ChEMBL
Target: Trypanosoma brucei
External Id: CHEMBL3832786
|
|
Name: Cytotoxicity against human HeLa cells assessed as reduction in cell viability after 4...
Source: ChEMBL
Target: HeLa
External Id: CHEMBL4369192
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of N-(2-aminoethyl)-2,4-dichloro-N-{4-[(4-chlorophenyl)methoxy]phenyl}benzamide? |
| A: InChIKey of N-(2-aminoethyl)-2,4-dichloro-N-{4-[(4-chlorophenyl)methoxy]phenyl}benzamide is KKZDZTJFDLFERF-UHFFFAOYSA-N. |
| Q: What is the CAS number of N-(2-aminoethyl)-2,4-dichloro-N-{4-[(4-chlorophenyl)methoxy]phenyl}benzamide? |
| A: CAS number of N-(2-aminoethyl)-2,4-dichloro-N-{4-[(4-chlorophenyl)methoxy]phenyl}benzamide is 2089056-76-6. |
| Q: What is the SMILES notation of N-(2-aminoethyl)-2,4-dichloro-N-{4-[(4-chlorophenyl)methoxy]phenyl}benzamide? |
| A: SMILES notation of N-(2-aminoethyl)-2,4-dichloro-N-{4-[(4-chlorophenyl)methoxy]phenyl}benzamide is NCCN(C(=O)c1ccc(Cl)cc1Cl)c1ccc(OCc2ccc(Cl)cc2)cc1. |
| Q: What is the Chinese name of 2089056-76-6? |
| A: Chinese name of 2089056-76-6 is 2089056-76-6. |
| Q: What is the molecular weight of N-(2-aminoethyl)-2,4-dichloro-N-{4-[(4-chlorophenyl)methoxy]phenyl}benzamide? |
| A: Molecular weight of N-(2-aminoethyl)-2,4-dichloro-N-{4-[(4-chlorophenyl)methoxy]phenyl}benzamide is 449.8. |
| Q: What is the molecular formula of N-(2-aminoethyl)-2,4-dichloro-N-{4-[(4-chlorophenyl)methoxy]phenyl}benzamide? |
| A: Molecular formula of N-(2-aminoethyl)-2,4-dichloro-N-{4-[(4-chlorophenyl)methoxy]phenyl}benzamide is C22H19Cl3N2O2. |
| Q: What is the English name of N-(2-aminoethyl)-2,4-dichloro-N-{4-[(4-chlorophenyl)methoxy]phenyl}benzamide? |
| A: The English name of N-(2-aminoethyl)-2,4-dichloro-N-{4-[(4-chlorophenyl)methoxy]phenyl}benzamide is N-(2-aminoethyl)-2,4-dichloro-N-{4-[(4-chlorophenyl)methoxy]phenyl}benzamide. |