6-p-Tolyloxy-nicotinic acid methyl ester
Modify Date: 2025-09-09 14:25:41
6-p-Tolyloxy-nicotinic acid methyl ester structure
|
Common Name | 6-p-Tolyloxy-nicotinic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 2089290-66-2 | Molecular Weight | 243.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-p-Tolyloxy-nicotinic acid methyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H13NO3 |
|---|---|
| Molecular Weight | 243.26 |
| InChIKey | CUKOGPJJOQCQBW-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(Oc2ccc(C)cc2)nc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 6-p-Tolyloxy-nicotinic acid methyl ester? |
| A: Molecular formula of 6-p-Tolyloxy-nicotinic acid methyl ester is C14H13NO3. |
| Q: What is the InChIKey of 6-p-Tolyloxy-nicotinic acid methyl ester? |
| A: InChIKey of 6-p-Tolyloxy-nicotinic acid methyl ester is CUKOGPJJOQCQBW-UHFFFAOYSA-N. |
| Q: What is the English name of 6-p-Tolyloxy-nicotinic acid methyl ester? |
| A: The English name of 6-p-Tolyloxy-nicotinic acid methyl ester is 6-p-Tolyloxy-nicotinic acid methyl ester. |
| Q: What is the molecular weight of 6-p-Tolyloxy-nicotinic acid methyl ester? |
| A: Molecular weight of 6-p-Tolyloxy-nicotinic acid methyl ester is 243.26. |
| Q: What is the CAS number of 6-p-Tolyloxy-nicotinic acid methyl ester? |
| A: CAS number of 6-p-Tolyloxy-nicotinic acid methyl ester is 2089290-66-2. |
| Q: What is the Chinese name of 2089290-66-2? |
| A: Chinese name of 2089290-66-2 is 2089290-66-2. |
| Q: What is the SMILES notation of 6-p-Tolyloxy-nicotinic acid methyl ester? |
| A: SMILES notation of 6-p-Tolyloxy-nicotinic acid methyl ester is COC(=O)c1ccc(Oc2ccc(C)cc2)nc1. |