[[[(4-methylphenyl)sulphonyl]oxy]imino]malononitrile structure
|
Common Name | [[[(4-methylphenyl)sulphonyl]oxy]imino]malononitrile | ||
|---|---|---|---|---|
| CAS Number | 20893-01-0 | Molecular Weight | 249.24600 | |
| Density | 1.31g/cm3 | Boiling Point | 391.4ºC at 760 mmHg | |
| Molecular Formula | C10H7N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.5ºC | |
| Name | (dicyanomethylideneamino) 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 391.4ºC at 760 mmHg |
| Molecular Formula | C10H7N3O3S |
| Molecular Weight | 249.24600 |
| Flash Point | 190.5ºC |
| Exact Mass | 249.02100 |
| PSA | 111.69000 |
| LogP | 2.18426 |
| Vapour Pressure | 2.48E-06mmHg at 25°C |
| Index of Refraction | 1.59 |
| InChIKey | XNCHCTURBIVYBC-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)ON=C(C#N)C#N)cc1 |
| HS Code | 2926909090 |
|---|
|
~%
[[[(4-methylphe... CAS#:20893-01-0 |
| Literature: Kinast, Guenther Liebigs Annalen der Chemie, 1981 , # 9 p. 1561 - 1567 |
|
~%
[[[(4-methylphe... CAS#:20893-01-0 |
| Literature: Lang, Marc; Schoeni, Jean-Paul; Pont, Christiane; Fleury, Jean-Pierre Helvetica Chimica Acta, 1986 , vol. 69, p. 793 - 802 |
|
~%
[[[(4-methylphe... CAS#:20893-01-0 |
| Literature: Kitamura, Mitsuru; Chiba, Shunsuke; Narasaka, Koichi Bulletin of the Chemical Society of Japan, 2003 , vol. 76, # 5 p. 1063 - 1070 |
| Precursor 4 | |
|---|---|
| DownStream 5 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| l'O-tosylisonitroso-malodinitrile |
| O-tosylisonitrosomalononitrile |
| O-tosyloximinomesoxalonitrile |
| O-tosyloximinomalononitrile |
| O-paratoluenesulphonylisonitrosomalodinitrile |