2,6-Pyridinedicarboxylic acid, 4-methyl-, hydrochloride
Modify Date: 2026-08-24 11:39:23
2,6-Pyridinedicarboxylic acid, 4-methyl-, hydrochloride structure
|
Common Name | 2,6-Pyridinedicarboxylic acid, 4-methyl-, hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2089312-68-3 | Molecular Weight | 217.60 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,6-Pyridinedicarboxylic acid, 4-methyl-, hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H8ClNO4 |
|---|---|
| Molecular Weight | 217.60 |
| InChIKey | FVCNLHHUFWJXJY-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(=O)O)nc(C(=O)O)c1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2,6-Pyridinedicarboxylic acid, 4-methyl-, hydrochloride? |
| A: InChIKey of 2,6-Pyridinedicarboxylic acid, 4-methyl-, hydrochloride is FVCNLHHUFWJXJY-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2,6-Pyridinedicarboxylic acid, 4-methyl-, hydrochloride? |
| A: SMILES notation of 2,6-Pyridinedicarboxylic acid, 4-methyl-, hydrochloride is Cc1cc(C(=O)O)nc(C(=O)O)c1.Cl. |
| Q: What is the molecular weight of 2,6-Pyridinedicarboxylic acid, 4-methyl-, hydrochloride? |
| A: Molecular weight of 2,6-Pyridinedicarboxylic acid, 4-methyl-, hydrochloride is 217.60. |
| Q: What is the molecular formula of 2,6-Pyridinedicarboxylic acid, 4-methyl-, hydrochloride? |
| A: Molecular formula of 2,6-Pyridinedicarboxylic acid, 4-methyl-, hydrochloride is C8H8ClNO4. |
| Q: What is the English name of 2,6-Pyridinedicarboxylic acid, 4-methyl-, hydrochloride? |
| A: The English name of 2,6-Pyridinedicarboxylic acid, 4-methyl-, hydrochloride is 2,6-Pyridinedicarboxylic acid, 4-methyl-, hydrochloride. |
| Q: What is the Chinese name of 2089312-68-3? |
| A: Chinese name of 2089312-68-3 is 2089312-68-3. |
| Q: What is the CAS number of 2,6-Pyridinedicarboxylic acid, 4-methyl-, hydrochloride? |
| A: CAS number of 2,6-Pyridinedicarboxylic acid, 4-methyl-, hydrochloride is 2089312-68-3. |