5-(Bromomethyl)-2-(trifluoromethyl)pyrimidine hydrobromide
Modify Date: 2025-09-04 12:17:47
5-(Bromomethyl)-2-(trifluoromethyl)pyrimidine hydrobromide structure
|
Common Name | 5-(Bromomethyl)-2-(trifluoromethyl)pyrimidine hydrobromide | ||
|---|---|---|---|---|
| CAS Number | 2089326-58-7 | Molecular Weight | 321.92 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H5Br2F3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(Bromomethyl)-2-(trifluoromethyl)pyrimidine hydrobromide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H5Br2F3N2 |
|---|---|
| Molecular Weight | 321.92 |
| InChIKey | JRYXIEPJNQQUSA-UHFFFAOYSA-N |
| SMILES | Br.FC(F)(F)c1ncc(CBr)cn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 5-(Bromomethyl)-2-(trifluoromethyl)pyrimidine hydrobromide? |
| A: Molecular weight of 5-(Bromomethyl)-2-(trifluoromethyl)pyrimidine hydrobromide is 321.92. |
| Q: What is the Chinese name of 2089326-58-7? |
| A: Chinese name of 2089326-58-7 is 2089326-58-7. |
| Q: What is the InChIKey of 5-(Bromomethyl)-2-(trifluoromethyl)pyrimidine hydrobromide? |
| A: InChIKey of 5-(Bromomethyl)-2-(trifluoromethyl)pyrimidine hydrobromide is JRYXIEPJNQQUSA-UHFFFAOYSA-N. |
| Q: What is the CAS number of 5-(Bromomethyl)-2-(trifluoromethyl)pyrimidine hydrobromide? |
| A: CAS number of 5-(Bromomethyl)-2-(trifluoromethyl)pyrimidine hydrobromide is 2089326-58-7. |
| Q: What is the English name of 5-(Bromomethyl)-2-(trifluoromethyl)pyrimidine hydrobromide? |
| A: The English name of 5-(Bromomethyl)-2-(trifluoromethyl)pyrimidine hydrobromide is 5-(Bromomethyl)-2-(trifluoromethyl)pyrimidine hydrobromide. |
| Q: What is the molecular formula of 5-(Bromomethyl)-2-(trifluoromethyl)pyrimidine hydrobromide? |
| A: Molecular formula of 5-(Bromomethyl)-2-(trifluoromethyl)pyrimidine hydrobromide is C6H5Br2F3N2. |
| Q: What is the SMILES notation of 5-(Bromomethyl)-2-(trifluoromethyl)pyrimidine hydrobromide? |
| A: SMILES notation of 5-(Bromomethyl)-2-(trifluoromethyl)pyrimidine hydrobromide is Br.FC(F)(F)c1ncc(CBr)cn1. |