(S)-Phenethyl 2-aminopropanoate hcl structure
|
Common Name | (S)-Phenethyl 2-aminopropanoate hcl | ||
|---|---|---|---|---|
| CAS Number | 2089671-99-6 | Molecular Weight | 229.70 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (S)-Phenethyl 2-aminopropanoate hcl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H16ClNO2 |
|---|---|
| Molecular Weight | 229.70 |
| InChIKey | XHRLZKYTVKGZTJ-FVGYRXGTSA-N |
| SMILES | CC(N)C(=O)OCCc1ccccc1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2089671-99-6? |
| A: Chinese name of 2089671-99-6 is 2089671-99-6. |
| Q: What is the molecular weight of (S)-Phenethyl 2-aminopropanoate hcl? |
| A: Molecular weight of (S)-Phenethyl 2-aminopropanoate hcl is 229.70. |
| Q: What is the SMILES notation of (S)-Phenethyl 2-aminopropanoate hcl? |
| A: SMILES notation of (S)-Phenethyl 2-aminopropanoate hcl is CC(N)C(=O)OCCc1ccccc1.Cl. |
| Q: What is the molecular formula of (S)-Phenethyl 2-aminopropanoate hcl? |
| A: Molecular formula of (S)-Phenethyl 2-aminopropanoate hcl is C11H16ClNO2. |
| Q: What is the InChIKey of (S)-Phenethyl 2-aminopropanoate hcl? |
| A: InChIKey of (S)-Phenethyl 2-aminopropanoate hcl is XHRLZKYTVKGZTJ-FVGYRXGTSA-N. |
| Q: What is the English name of (S)-Phenethyl 2-aminopropanoate hcl? |
| A: The English name of (S)-Phenethyl 2-aminopropanoate hcl is (S)-Phenethyl 2-aminopropanoate hcl. |
| Q: What is the CAS number of (S)-Phenethyl 2-aminopropanoate hcl? |
| A: CAS number of (S)-Phenethyl 2-aminopropanoate hcl is 2089671-99-6. |