4-methylbenzenesulfonic acid structure
|
Common Name | 4-methylbenzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 2090-08-6 | Molecular Weight | 309.52900 | |
| Density | 1.34g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H8BaO3S++ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | barium(2+),4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Molecular Formula | C7H8BaO3S++ |
| Molecular Weight | 309.52900 |
| Exact Mass | 309.92500 |
| PSA | 62.75000 |
| LogP | 2.32250 |
| InChIKey | JTRGEBZVNIQMHI-UHFFFAOYSA-L |
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1.Cc1ccc(S(=O)(=O)[O-])cc1.[Ba+2] |
|
~%
4-methylbenzene... CAS#:2090-08-6 |
| Literature: Frankland, Andrew D.; Lappert, Michael F. Journal of the Chemical Society - Dalton Transactions, 1996 , # 22 p. 4151 - 4152 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| EINECS 218-237-5 |
| p-toluenesulfonic acid,barium salt |
| Ba-Salz von p-Toluolsulfonsaeure |
| Toluol-4-sulfonsaeure,Barium-Verbindung |
| barium p-toluenesulfonate |
| toluene-4-sulfonic acid,barium compound |