7-Nitro-1,5-naphthyridine-2,8-diol
Modify Date: 2026-07-20 15:57:49
7-Nitro-1,5-naphthyridine-2,8-diol structure
|
Common Name | 7-Nitro-1,5-naphthyridine-2,8-diol | ||
|---|---|---|---|---|
| CAS Number | 2090053-99-7 | Molecular Weight | 207.14 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-Nitro-1,5-naphthyridine-2,8-diol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H5N3O4 |
|---|---|
| Molecular Weight | 207.14 |
| InChIKey | BXDDZNZTAWJANG-UHFFFAOYSA-N |
| SMILES | O=c1ccc2[nH]cc([N+](=O)[O-])c(=O)c2[nH]1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 7-Nitro-1,5-naphthyridine-2,8-diol? |
| A: Molecular formula of 7-Nitro-1,5-naphthyridine-2,8-diol is C8H5N3O4. |
| Q: What is the Chinese name of 2090053-99-7? |
| A: Chinese name of 2090053-99-7 is 2090053-99-7. |
| Q: What is the SMILES notation of 7-Nitro-1,5-naphthyridine-2,8-diol? |
| A: SMILES notation of 7-Nitro-1,5-naphthyridine-2,8-diol is O=c1ccc2[nH]cc([N+](=O)[O-])c(=O)c2[nH]1. |
| Q: What is the CAS number of 7-Nitro-1,5-naphthyridine-2,8-diol? |
| A: CAS number of 7-Nitro-1,5-naphthyridine-2,8-diol is 2090053-99-7. |
| Q: What is the InChIKey of 7-Nitro-1,5-naphthyridine-2,8-diol? |
| A: InChIKey of 7-Nitro-1,5-naphthyridine-2,8-diol is BXDDZNZTAWJANG-UHFFFAOYSA-N. |
| Q: What is the English name of 7-Nitro-1,5-naphthyridine-2,8-diol? |
| A: The English name of 7-Nitro-1,5-naphthyridine-2,8-diol is 7-Nitro-1,5-naphthyridine-2,8-diol. |
| Q: What is the molecular weight of 7-Nitro-1,5-naphthyridine-2,8-diol? |
| A: Molecular weight of 7-Nitro-1,5-naphthyridine-2,8-diol is 207.14. |