L-Lysine thioctate
L-Lysine thioctate structure
|
Common Name | L-Lysine thioctate | ||
|---|---|---|---|---|
| CAS Number | 20902-53-8 | Molecular Weight | 352.51 | |
| Density | N/A | Boiling Point | 362.5ºC at 760mmHg | |
| Molecular Formula | C14H28N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173ºC | |
Use of L-Lysine thioctateL-Lysine thioctate is a substrate of lipoamidase[1]. |
Summary: L-Lysine thioctate, also known as (2S)-2,6-diaminohexanoic acid: 5-(dithiolan-3-yl)pentanoic acid, CAS number 20902-53-8, with molecular formula C14H28N2O4S2 and molecular weight 352.51. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2S)-2,6-diaminohexanoic acid: 5-(dithiolan-3-yl)pentanoic acid |
|---|---|
| Synonym | More Synonyms |
This table contains bioactivity, target information and biological‑assay experimental data of this compound.
| Description | L-Lysine thioctate is a substrate of lipoamidase[1]. |
|---|---|
| Related Catalog | |
| References |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 362.5ºC at 760mmHg |
|---|---|
| Molecular Formula | C14H28N2O4S2 |
| Molecular Weight | 352.51 |
| Flash Point | 173ºC |
| Exact Mass | 570.47600 |
| PSA | 92.42000 |
| LogP | 8.90360 |
| Vapour Pressure | 3.07E-06mmHg at 25°C |
| InChIKey | WCHWQPTUXDMALZ-ZSCHJXSPSA-N |
| SMILES | NCCCCC(N)C(=O)O.O=C(O)CCCCC1CCSS1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| lipoyllysine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (2S)-2,6-diaminohexanoic acid: 5-(dithiolan-3-yl)pentanoic acid? |
| A: Molecular formula of (2S)-2,6-diaminohexanoic acid: 5-(dithiolan-3-yl)pentanoic acid is C14H28N2O4S2. |
| Q: What is the polar surface area (PSA) of (2S)-2,6-diaminohexanoic acid: 5-(dithiolan-3-yl)pentanoic acid? |
| A: Polar surface area (PSA) of (2S)-2,6-diaminohexanoic acid: 5-(dithiolan-3-yl)pentanoic acid is 92.42000. |
| Q: What is the CAS number of (2S)-2,6-diaminohexanoic acid: 5-(dithiolan-3-yl)pentanoic acid? |
| A: CAS number of (2S)-2,6-diaminohexanoic acid: 5-(dithiolan-3-yl)pentanoic acid is 20902-53-8. |
| Q: What is the SMILES notation of (2S)-2,6-diaminohexanoic acid: 5-(dithiolan-3-yl)pentanoic acid? |
| A: SMILES notation of (2S)-2,6-diaminohexanoic acid: 5-(dithiolan-3-yl)pentanoic acid is NCCCCC(N)C(=O)O.O=C(O)CCCCC1CCSS1. |
| Q: What is the InChIKey of (2S)-2,6-diaminohexanoic acid: 5-(dithiolan-3-yl)pentanoic acid? |
| A: InChIKey of (2S)-2,6-diaminohexanoic acid: 5-(dithiolan-3-yl)pentanoic acid is WCHWQPTUXDMALZ-ZSCHJXSPSA-N. |
| Q: What is the LogP of (2S)-2,6-diaminohexanoic acid: 5-(dithiolan-3-yl)pentanoic acid? |
| A: LogP of (2S)-2,6-diaminohexanoic acid: 5-(dithiolan-3-yl)pentanoic acid is 8.90360. |
| Q: What are the uses of (2S)-2,6-diaminohexanoic acid: 5-(dithiolan-3-yl)pentanoic acid? |
| A: Main uses of (2S)-2,6-diaminohexanoic acid: 5-(dithiolan-3-yl)pentanoic acid: L-Lysine thioctate is a substrate of lipoamidase[1]. |
| Q: What is the English name of (2S)-2,6-diaminohexanoic acid: 5-(dithiolan-3-yl)pentanoic acid? |
| A: The English name of (2S)-2,6-diaminohexanoic acid: 5-(dithiolan-3-yl)pentanoic acid is (2S)-2,6-diaminohexanoic acid: 5-(dithiolan-3-yl)pentanoic acid. |
| Q: What is the molecular weight of (2S)-2,6-diaminohexanoic acid: 5-(dithiolan-3-yl)pentanoic acid? |
| A: Molecular weight of (2S)-2,6-diaminohexanoic acid: 5-(dithiolan-3-yl)pentanoic acid is 352.51. |
| Q: What is the boiling point of (2S)-2,6-diaminohexanoic acid: 5-(dithiolan-3-yl)pentanoic acid? |
| A: Boiling point of (2S)-2,6-diaminohexanoic acid: 5-(dithiolan-3-yl)pentanoic acid is 362.5ºC at 760mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |