4-(2,2,3,3-Tetrafluorocyclobutyl)benzaldehyde
Modify Date: 2026-07-07 20:02:50
4-(2,2,3,3-Tetrafluorocyclobutyl)benzaldehyde structure
|
Common Name | 4-(2,2,3,3-Tetrafluorocyclobutyl)benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 2090270-29-2 | Molecular Weight | 232.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8F4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(2,2,3,3-Tetrafluorocyclobutyl)benzaldehyde |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H8F4O |
|---|---|
| Molecular Weight | 232.17 |
| InChIKey | VRNNZTGRDHNSRV-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(C2CC(F)(F)C2(F)F)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-(2,2,3,3-Tetrafluorocyclobutyl)benzaldehyde? |
| A: Molecular formula of 4-(2,2,3,3-Tetrafluorocyclobutyl)benzaldehyde is C11H8F4O. |
| Q: What is the molecular weight of 4-(2,2,3,3-Tetrafluorocyclobutyl)benzaldehyde? |
| A: Molecular weight of 4-(2,2,3,3-Tetrafluorocyclobutyl)benzaldehyde is 232.17. |
| Q: What is the Chinese name of 2090270-29-2? |
| A: Chinese name of 2090270-29-2 is 2090270-29-2. |
| Q: What is the SMILES notation of 4-(2,2,3,3-Tetrafluorocyclobutyl)benzaldehyde? |
| A: SMILES notation of 4-(2,2,3,3-Tetrafluorocyclobutyl)benzaldehyde is O=Cc1ccc(C2CC(F)(F)C2(F)F)cc1. |
| Q: What is the InChIKey of 4-(2,2,3,3-Tetrafluorocyclobutyl)benzaldehyde? |
| A: InChIKey of 4-(2,2,3,3-Tetrafluorocyclobutyl)benzaldehyde is VRNNZTGRDHNSRV-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4-(2,2,3,3-Tetrafluorocyclobutyl)benzaldehyde? |
| A: CAS number of 4-(2,2,3,3-Tetrafluorocyclobutyl)benzaldehyde is 2090270-29-2. |
| Q: What is the English name of 4-(2,2,3,3-Tetrafluorocyclobutyl)benzaldehyde? |
| A: The English name of 4-(2,2,3,3-Tetrafluorocyclobutyl)benzaldehyde is 4-(2,2,3,3-Tetrafluorocyclobutyl)benzaldehyde. |