Benzamide,3,5-dibromo-N-[(4-chlorophenyl)methyl]-2-hydroxy- structure
|
Common Name | Benzamide,3,5-dibromo-N-[(4-chlorophenyl)methyl]-2-hydroxy- | ||
|---|---|---|---|---|
| CAS Number | 20907-42-0 | Molecular Weight | 419.49600 | |
| Density | 1.798g/cm3 | Boiling Point | 454.7ºC at 760 mmHg | |
| Molecular Formula | C14H10Br2ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.8ºC | |
| Name | 3,5-dibromo-N-[(4-chlorophenyl)methyl]-2-hydroxybenzamide |
|---|
| Density | 1.798g/cm3 |
|---|---|
| Boiling Point | 454.7ºC at 760 mmHg |
| Molecular Formula | C14H10Br2ClNO2 |
| Molecular Weight | 419.49600 |
| Flash Point | 228.8ºC |
| Exact Mass | 416.87700 |
| PSA | 49.33000 |
| LogP | 4.89150 |
| Vapour Pressure | 6.9E-09mmHg at 25°C |
| Index of Refraction | 1.664 |
| InChIKey | QACPZYAGNNAVHQ-UHFFFAOYSA-N |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1cc(Br)cc(Br)c1O |
|
~65%
Benzamide,3,5-d... CAS#:20907-42-0 |
| Literature: Waisser, Karel; Perina, Milan; Klimesova, Vera; Kaustova, Jarmila Collection of Czechoslovak Chemical Communications, 2003 , vol. 68, # 7 p. 1275 - 1294 |
|
~%
Benzamide,3,5-d... CAS#:20907-42-0 |
| Literature: Coburn; Batista; Evans; Genco Journal of Medicinal Chemistry, 1981 , vol. 24, # 10 p. 1245 - 1249 |
|
~%
Benzamide,3,5-d... CAS#:20907-42-0 |
| Literature: Coburn; Batista; Evans; Genco Journal of Medicinal Chemistry, 1981 , vol. 24, # 10 p. 1245 - 1249 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |