2-oxo-1,2,3,4,5,6-hexahydro-4aH-cyclopenta[b]pyridine-4a-carboxylic acid
Modify Date: 2025-09-10 07:25:16
![2-oxo-1,2,3,4,5,6-hexahydro-4aH-cyclopenta[b]pyridine-4a-carboxylic acid Structure](https://www.chemsrc.com/extcaspic/071/2090909-90-1.png)
2-oxo-1,2,3,4,5,6-hexahydro-4aH-cyclopenta[b]pyridine-4a-carboxylic acid structure
|
Common Name | 2-oxo-1,2,3,4,5,6-hexahydro-4aH-cyclopenta[b]pyridine-4a-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2090909-90-1 | Molecular Weight | 181.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-oxo-1,2,3,4,5,6-hexahydro-4aH-cyclopenta[b]pyridine-4a-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H11NO3 |
|---|---|
| Molecular Weight | 181.19 |
| InChIKey | JYVFPDAIIWUNQE-UHFFFAOYSA-N |
| SMILES | O=C1CCC2(C(=O)O)CCC=C2N1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-oxo-1,2,3,4,5,6-hexahydro-4aH-cyclopenta[b]pyridine-4a-carboxylic acid? |
| A: InChIKey of 2-oxo-1,2,3,4,5,6-hexahydro-4aH-cyclopenta[b]pyridine-4a-carboxylic acid is JYVFPDAIIWUNQE-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-oxo-1,2,3,4,5,6-hexahydro-4aH-cyclopenta[b]pyridine-4a-carboxylic acid? |
| A: CAS number of 2-oxo-1,2,3,4,5,6-hexahydro-4aH-cyclopenta[b]pyridine-4a-carboxylic acid is 2090909-90-1. |
| Q: What is the Chinese name of 2090909-90-1? |
| A: Chinese name of 2090909-90-1 is 2090909-90-1. |
| Q: What is the molecular weight of 2-oxo-1,2,3,4,5,6-hexahydro-4aH-cyclopenta[b]pyridine-4a-carboxylic acid? |
| A: Molecular weight of 2-oxo-1,2,3,4,5,6-hexahydro-4aH-cyclopenta[b]pyridine-4a-carboxylic acid is 181.19. |
| Q: What is the English name of 2-oxo-1,2,3,4,5,6-hexahydro-4aH-cyclopenta[b]pyridine-4a-carboxylic acid? |
| A: The English name of 2-oxo-1,2,3,4,5,6-hexahydro-4aH-cyclopenta[b]pyridine-4a-carboxylic acid is 2-oxo-1,2,3,4,5,6-hexahydro-4aH-cyclopenta[b]pyridine-4a-carboxylic acid. |
| Q: What is the molecular formula of 2-oxo-1,2,3,4,5,6-hexahydro-4aH-cyclopenta[b]pyridine-4a-carboxylic acid? |
| A: Molecular formula of 2-oxo-1,2,3,4,5,6-hexahydro-4aH-cyclopenta[b]pyridine-4a-carboxylic acid is C9H11NO3. |
| Q: What is the SMILES notation of 2-oxo-1,2,3,4,5,6-hexahydro-4aH-cyclopenta[b]pyridine-4a-carboxylic acid? |
| A: SMILES notation of 2-oxo-1,2,3,4,5,6-hexahydro-4aH-cyclopenta[b]pyridine-4a-carboxylic acid is O=C1CCC2(C(=O)O)CCC=C2N1. |