Methyl 5-bromobenzo[d][1,3]dioxole-2-carboxylate
Modify Date: 2025-09-10 18:54:35
![Methyl 5-bromobenzo[d][1,3]dioxole-2-carboxylate Structure](https://www.chemsrc.com/extcaspic/426/2090979-71-6.png)
Methyl 5-bromobenzo[d][1,3]dioxole-2-carboxylate structure
|
Common Name | Methyl 5-bromobenzo[d][1,3]dioxole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2090979-71-6 | Molecular Weight | 259.05 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 5-bromobenzo[d][1,3]dioxole-2-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H7BrO4 |
|---|---|
| Molecular Weight | 259.05 |
| InChIKey | YDKQKGZIOYHOIJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1Oc2ccc(Br)cc2O1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Methyl 5-bromobenzo[d][1,3]dioxole-2-carboxylate? |
| A: Molecular weight of Methyl 5-bromobenzo[d][1,3]dioxole-2-carboxylate is 259.05. |
| Q: What is the InChIKey of Methyl 5-bromobenzo[d][1,3]dioxole-2-carboxylate? |
| A: InChIKey of Methyl 5-bromobenzo[d][1,3]dioxole-2-carboxylate is YDKQKGZIOYHOIJ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2090979-71-6? |
| A: Chinese name of 2090979-71-6 is 2090979-71-6. |
| Q: What is the CAS number of Methyl 5-bromobenzo[d][1,3]dioxole-2-carboxylate? |
| A: CAS number of Methyl 5-bromobenzo[d][1,3]dioxole-2-carboxylate is 2090979-71-6. |
| Q: What is the molecular formula of Methyl 5-bromobenzo[d][1,3]dioxole-2-carboxylate? |
| A: Molecular formula of Methyl 5-bromobenzo[d][1,3]dioxole-2-carboxylate is C9H7BrO4. |
| Q: What is the English name of Methyl 5-bromobenzo[d][1,3]dioxole-2-carboxylate? |
| A: The English name of Methyl 5-bromobenzo[d][1,3]dioxole-2-carboxylate is Methyl 5-bromobenzo[d][1,3]dioxole-2-carboxylate. |
| Q: What is the SMILES notation of Methyl 5-bromobenzo[d][1,3]dioxole-2-carboxylate? |
| A: SMILES notation of Methyl 5-bromobenzo[d][1,3]dioxole-2-carboxylate is COC(=O)C1Oc2ccc(Br)cc2O1. |