4-(thiophen-3-yl)-1H-1,2,3-triazole-5-carboxylic acid
Modify Date: 2026-07-31 16:23:54
4-(thiophen-3-yl)-1H-1,2,3-triazole-5-carboxylic acid structure
|
Common Name | 4-(thiophen-3-yl)-1H-1,2,3-triazole-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2091775-74-3 | Molecular Weight | 195.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H5N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(thiophen-3-yl)-1H-1,2,3-triazole-5-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H5N3O2S |
|---|---|
| Molecular Weight | 195.20 |
| InChIKey | FXMDCKCWFGJYCU-UHFFFAOYSA-N |
| SMILES | O=C(O)c1n[nH]nc1-c1ccsc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-(thiophen-3-yl)-1H-1,2,3-triazole-5-carboxylic acid? |
| A: CAS number of 4-(thiophen-3-yl)-1H-1,2,3-triazole-5-carboxylic acid is 2091775-74-3. |
| Q: What is the SMILES notation of 4-(thiophen-3-yl)-1H-1,2,3-triazole-5-carboxylic acid? |
| A: SMILES notation of 4-(thiophen-3-yl)-1H-1,2,3-triazole-5-carboxylic acid is O=C(O)c1n[nH]nc1-c1ccsc1. |
| Q: What is the InChIKey of 4-(thiophen-3-yl)-1H-1,2,3-triazole-5-carboxylic acid? |
| A: InChIKey of 4-(thiophen-3-yl)-1H-1,2,3-triazole-5-carboxylic acid is FXMDCKCWFGJYCU-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-(thiophen-3-yl)-1H-1,2,3-triazole-5-carboxylic acid? |
| A: Molecular formula of 4-(thiophen-3-yl)-1H-1,2,3-triazole-5-carboxylic acid is C7H5N3O2S. |
| Q: What is the English name of 4-(thiophen-3-yl)-1H-1,2,3-triazole-5-carboxylic acid? |
| A: The English name of 4-(thiophen-3-yl)-1H-1,2,3-triazole-5-carboxylic acid is 4-(thiophen-3-yl)-1H-1,2,3-triazole-5-carboxylic acid. |
| Q: What is the molecular weight of 4-(thiophen-3-yl)-1H-1,2,3-triazole-5-carboxylic acid? |
| A: Molecular weight of 4-(thiophen-3-yl)-1H-1,2,3-triazole-5-carboxylic acid is 195.20. |
| Q: What is the Chinese name of 2091775-74-3? |
| A: Chinese name of 2091775-74-3 is 2091775-74-3. |