7-(2-aminoethyl)-3-ethyl-[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one
Modify Date: 2026-08-19 10:56:24
![7-(2-aminoethyl)-3-ethyl-[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one Structure](https://www.chemsrc.com/extcaspic/370/2092032-79-4.png)
7-(2-aminoethyl)-3-ethyl-[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one structure
|
Common Name | 7-(2-aminoethyl)-3-ethyl-[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one | ||
|---|---|---|---|---|
| CAS Number | 2092032-79-4 | Molecular Weight | 207.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H13N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-(2-aminoethyl)-3-ethyl-[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H13N5O |
|---|---|
| Molecular Weight | 207.23 |
| InChIKey | ABVCADAWORLIHN-UHFFFAOYSA-N |
| SMILES | CCc1nnc2c(=O)n(CCN)ccn12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 7-(2-aminoethyl)-3-ethyl-[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one? |
| A: SMILES notation of 7-(2-aminoethyl)-3-ethyl-[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one is CCc1nnc2c(=O)n(CCN)ccn12. |
| Q: What is the CAS number of 7-(2-aminoethyl)-3-ethyl-[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one? |
| A: CAS number of 7-(2-aminoethyl)-3-ethyl-[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one is 2092032-79-4. |
| Q: What is the molecular formula of 7-(2-aminoethyl)-3-ethyl-[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one? |
| A: Molecular formula of 7-(2-aminoethyl)-3-ethyl-[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one is C9H13N5O. |
| Q: What is the molecular weight of 7-(2-aminoethyl)-3-ethyl-[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one? |
| A: Molecular weight of 7-(2-aminoethyl)-3-ethyl-[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one is 207.23. |
| Q: What is the Chinese name of 2092032-79-4? |
| A: Chinese name of 2092032-79-4 is 2092032-79-4. |
| Q: What is the InChIKey of 7-(2-aminoethyl)-3-ethyl-[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one? |
| A: InChIKey of 7-(2-aminoethyl)-3-ethyl-[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one is ABVCADAWORLIHN-UHFFFAOYSA-N. |
| Q: What is the English name of 7-(2-aminoethyl)-3-ethyl-[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one? |
| A: The English name of 7-(2-aminoethyl)-3-ethyl-[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one is 7-(2-aminoethyl)-3-ethyl-[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one. |