6-isobutyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid
Modify Date: 2026-08-02 18:36:35
![6-isobutyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid Structure](https://www.chemsrc.com/extcaspic/358/2092287-68-6.png)
6-isobutyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid structure
|
Common Name | 6-isobutyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2092287-68-6 | Molecular Weight | 223.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-isobutyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H13NO2S |
|---|---|
| Molecular Weight | 223.29 |
| InChIKey | CFNZMKDHWBEIIN-UHFFFAOYSA-N |
| SMILES | CC(C)Cn1c(C(=O)O)cc2ccsc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 6-isobutyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid? |
| A: InChIKey of 6-isobutyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid is CFNZMKDHWBEIIN-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 6-isobutyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid? |
| A: Molecular weight of 6-isobutyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid is 223.29. |
| Q: What is the molecular formula of 6-isobutyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid? |
| A: Molecular formula of 6-isobutyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid is C11H13NO2S. |
| Q: What is the English name of 6-isobutyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid? |
| A: The English name of 6-isobutyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid is 6-isobutyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid. |
| Q: What is the Chinese name of 2092287-68-6? |
| A: Chinese name of 2092287-68-6 is 2092287-68-6. |
| Q: What is the SMILES notation of 6-isobutyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid? |
| A: SMILES notation of 6-isobutyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid is CC(C)Cn1c(C(=O)O)cc2ccsc21. |
| Q: What is the CAS number of 6-isobutyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid? |
| A: CAS number of 6-isobutyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid is 2092287-68-6. |