8-Bromo-4-chloro-3-nitro-1,6-naphthyridine
Modify Date: 2026-07-29 07:51:10
8-Bromo-4-chloro-3-nitro-1,6-naphthyridine structure
|
Common Name | 8-Bromo-4-chloro-3-nitro-1,6-naphthyridine | ||
|---|---|---|---|---|
| CAS Number | 2092587-25-0 | Molecular Weight | 288.48 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H3BrClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 8-Bromo-4-chloro-3-nitro-1,6-naphthyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H3BrClN3O2 |
|---|---|
| Molecular Weight | 288.48 |
| InChIKey | KWCFLUGEJCAASS-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cnc2c(Br)cncc2c1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 8-Bromo-4-chloro-3-nitro-1,6-naphthyridine? |
| A: Molecular formula of 8-Bromo-4-chloro-3-nitro-1,6-naphthyridine is C8H3BrClN3O2. |
| Q: What is the English name of 8-Bromo-4-chloro-3-nitro-1,6-naphthyridine? |
| A: The English name of 8-Bromo-4-chloro-3-nitro-1,6-naphthyridine is 8-Bromo-4-chloro-3-nitro-1,6-naphthyridine. |
| Q: What is the SMILES notation of 8-Bromo-4-chloro-3-nitro-1,6-naphthyridine? |
| A: SMILES notation of 8-Bromo-4-chloro-3-nitro-1,6-naphthyridine is O=[N+]([O-])c1cnc2c(Br)cncc2c1Cl. |
| Q: What is the molecular weight of 8-Bromo-4-chloro-3-nitro-1,6-naphthyridine? |
| A: Molecular weight of 8-Bromo-4-chloro-3-nitro-1,6-naphthyridine is 288.48. |
| Q: What is the Chinese name of 2092587-25-0? |
| A: Chinese name of 2092587-25-0 is 2092587-25-0. |
| Q: What is the InChIKey of 8-Bromo-4-chloro-3-nitro-1,6-naphthyridine? |
| A: InChIKey of 8-Bromo-4-chloro-3-nitro-1,6-naphthyridine is KWCFLUGEJCAASS-UHFFFAOYSA-N. |
| Q: What is the CAS number of 8-Bromo-4-chloro-3-nitro-1,6-naphthyridine? |
| A: CAS number of 8-Bromo-4-chloro-3-nitro-1,6-naphthyridine is 2092587-25-0. |