5-(chloromethyl)-1-(3,5-difluorobenzyl)-1H-imidazole
Modify Date: 2026-07-17 18:37:31
5-(chloromethyl)-1-(3,5-difluorobenzyl)-1H-imidazole structure
|
Common Name | 5-(chloromethyl)-1-(3,5-difluorobenzyl)-1H-imidazole | ||
|---|---|---|---|---|
| CAS Number | 2092640-21-4 | Molecular Weight | 242.65 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9ClF2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(chloromethyl)-1-(3,5-difluorobenzyl)-1H-imidazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H9ClF2N2 |
|---|---|
| Molecular Weight | 242.65 |
| InChIKey | PNRCNMBZZMLKKF-UHFFFAOYSA-N |
| SMILES | Fc1cc(F)cc(Cn2cncc2CCl)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 5-(chloromethyl)-1-(3,5-difluorobenzyl)-1H-imidazole? |
| A: InChIKey of 5-(chloromethyl)-1-(3,5-difluorobenzyl)-1H-imidazole is PNRCNMBZZMLKKF-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2092640-21-4? |
| A: Chinese name of 2092640-21-4 is 2092640-21-4. |
| Q: What is the English name of 5-(chloromethyl)-1-(3,5-difluorobenzyl)-1H-imidazole? |
| A: The English name of 5-(chloromethyl)-1-(3,5-difluorobenzyl)-1H-imidazole is 5-(chloromethyl)-1-(3,5-difluorobenzyl)-1H-imidazole. |
| Q: What is the CAS number of 5-(chloromethyl)-1-(3,5-difluorobenzyl)-1H-imidazole? |
| A: CAS number of 5-(chloromethyl)-1-(3,5-difluorobenzyl)-1H-imidazole is 2092640-21-4. |
| Q: What is the molecular formula of 5-(chloromethyl)-1-(3,5-difluorobenzyl)-1H-imidazole? |
| A: Molecular formula of 5-(chloromethyl)-1-(3,5-difluorobenzyl)-1H-imidazole is C11H9ClF2N2. |
| Q: What is the SMILES notation of 5-(chloromethyl)-1-(3,5-difluorobenzyl)-1H-imidazole? |
| A: SMILES notation of 5-(chloromethyl)-1-(3,5-difluorobenzyl)-1H-imidazole is Fc1cc(F)cc(Cn2cncc2CCl)c1. |
| Q: What is the molecular weight of 5-(chloromethyl)-1-(3,5-difluorobenzyl)-1H-imidazole? |
| A: Molecular weight of 5-(chloromethyl)-1-(3,5-difluorobenzyl)-1H-imidazole is 242.65. |