Imidazolysine
Modify Date: 2026-09-27 09:53:44
Imidazolysine structure
|
Common Name | Imidazolysine | ||
|---|---|---|---|---|
| CAS Number | 209276-80-2 | Molecular Weight | 341.43 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H29N4O4+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Imidazolysine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H29N4O4+ |
|---|---|
| Molecular Weight | 341.43 |
| InChIKey | NVJLIMSDAPOFHF-KBPBESRZSA-O |
| SMILES | Cc1c[n+](CCCCC(N)C(=O)O)cn1CCCCC(N)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Imidazolysine? |
| A: CAS number of Imidazolysine is 209276-80-2. |
| Q: What is the molecular formula of Imidazolysine? |
| A: Molecular formula of Imidazolysine is C16H29N4O4+. |
| Q: What is the InChIKey of Imidazolysine? |
| A: InChIKey of Imidazolysine is NVJLIMSDAPOFHF-KBPBESRZSA-O. |
| Q: What is the Chinese name of 209276-80-2? |
| A: Chinese name of 209276-80-2 is 209276-80-2. |
| Q: What is the English name of Imidazolysine? |
| A: The English name of Imidazolysine is Imidazolysine. |
| Q: What is the SMILES notation of Imidazolysine? |
| A: SMILES notation of Imidazolysine is Cc1c[n+](CCCCC(N)C(=O)O)cn1CCCCC(N)C(=O)O. |
| Q: What is the molecular weight of Imidazolysine? |
| A: Molecular weight of Imidazolysine is 341.43. |