1-ethyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide
Modify Date: 2026-07-22 16:39:24
![1-ethyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide Structure](https://www.chemsrc.com/extcaspic/444/2092798-59-7.png)
1-ethyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide structure
|
Common Name | 1-ethyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide | ||
|---|---|---|---|---|
| CAS Number | 2092798-59-7 | Molecular Weight | 227.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-ethyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H13NO3S |
|---|---|
| Molecular Weight | 227.28 |
| InChIKey | COBZJTXAGZYYNA-UHFFFAOYSA-N |
| SMILES | CCN1c2ccccc2C(O)CS1(=O)=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1-ethyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide? |
| A: CAS number of 1-ethyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide is 2092798-59-7. |
| Q: What is the Chinese name of 2092798-59-7? |
| A: Chinese name of 2092798-59-7 is 2092798-59-7. |
| Q: What is the molecular formula of 1-ethyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide? |
| A: Molecular formula of 1-ethyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide is C10H13NO3S. |
| Q: What is the InChIKey of 1-ethyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide? |
| A: InChIKey of 1-ethyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide is COBZJTXAGZYYNA-UHFFFAOYSA-N. |
| Q: What is the English name of 1-ethyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide? |
| A: The English name of 1-ethyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide is 1-ethyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide. |
| Q: What is the molecular weight of 1-ethyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide? |
| A: Molecular weight of 1-ethyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide is 227.28. |
| Q: What is the SMILES notation of 1-ethyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide? |
| A: SMILES notation of 1-ethyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide is CCN1c2ccccc2C(O)CS1(=O)=O. |