(2,4-Dimethoxybenzyl)hydrazine Dihydrochloride
Modify Date: 2026-09-27 22:04:17
(2,4-Dimethoxybenzyl)hydrazine Dihydrochloride structure
|
Common Name | (2,4-Dimethoxybenzyl)hydrazine Dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2093977-97-8 | Molecular Weight | 255.14 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H16Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2,4-Dimethoxybenzyl)hydrazine Dihydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H16Cl2N2O2 |
|---|---|
| Molecular Weight | 255.14 |
| InChIKey | KGSNTXURCGYSCM-UHFFFAOYSA-N |
| SMILES | COc1ccc(CNN)c(OC)c1.Cl.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2093977-97-8? |
| A: Chinese name of 2093977-97-8 is 2093977-97-8. |
| Q: What is the CAS number of (2,4-Dimethoxybenzyl)hydrazine Dihydrochloride? |
| A: CAS number of (2,4-Dimethoxybenzyl)hydrazine Dihydrochloride is 2093977-97-8. |
| Q: What is the molecular weight of (2,4-Dimethoxybenzyl)hydrazine Dihydrochloride? |
| A: Molecular weight of (2,4-Dimethoxybenzyl)hydrazine Dihydrochloride is 255.14. |
| Q: What is the InChIKey of (2,4-Dimethoxybenzyl)hydrazine Dihydrochloride? |
| A: InChIKey of (2,4-Dimethoxybenzyl)hydrazine Dihydrochloride is KGSNTXURCGYSCM-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of (2,4-Dimethoxybenzyl)hydrazine Dihydrochloride? |
| A: SMILES notation of (2,4-Dimethoxybenzyl)hydrazine Dihydrochloride is COc1ccc(CNN)c(OC)c1.Cl.Cl. |
| Q: What is the English name of (2,4-Dimethoxybenzyl)hydrazine Dihydrochloride? |
| A: The English name of (2,4-Dimethoxybenzyl)hydrazine Dihydrochloride is (2,4-Dimethoxybenzyl)hydrazine Dihydrochloride. |
| Q: What is the molecular formula of (2,4-Dimethoxybenzyl)hydrazine Dihydrochloride? |
| A: Molecular formula of (2,4-Dimethoxybenzyl)hydrazine Dihydrochloride is C9H16Cl2N2O2. |