4,6-Dichloro-3-cyclobutyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine
Modify Date: 2025-09-09 17:28:21
![4,6-Dichloro-3-cyclobutyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine Structure](https://www.chemsrc.com/extcaspic/242/2093978-87-9.png)
4,6-Dichloro-3-cyclobutyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine structure
|
Common Name | 4,6-Dichloro-3-cyclobutyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine | ||
|---|---|---|---|---|
| CAS Number | 2093978-87-9 | Molecular Weight | 318.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13Cl2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,6-Dichloro-3-cyclobutyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H13Cl2N3 |
|---|---|
| Molecular Weight | 318.2 |
| InChIKey | HMJFUYRASILDMM-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)c2c(C3CCC3)nn(-c3ccccc3)c2n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4,6-Dichloro-3-cyclobutyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine? |
| A: SMILES notation of 4,6-Dichloro-3-cyclobutyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine is Clc1cc(Cl)c2c(C3CCC3)nn(-c3ccccc3)c2n1. |
| Q: What is the molecular formula of 4,6-Dichloro-3-cyclobutyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine? |
| A: Molecular formula of 4,6-Dichloro-3-cyclobutyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine is C16H13Cl2N3. |
| Q: What is the Chinese name of 2093978-87-9? |
| A: Chinese name of 2093978-87-9 is 2093978-87-9. |
| Q: What is the English name of 4,6-Dichloro-3-cyclobutyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine? |
| A: The English name of 4,6-Dichloro-3-cyclobutyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine is 4,6-Dichloro-3-cyclobutyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine. |
| Q: What is the InChIKey of 4,6-Dichloro-3-cyclobutyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine? |
| A: InChIKey of 4,6-Dichloro-3-cyclobutyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine is HMJFUYRASILDMM-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4,6-Dichloro-3-cyclobutyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine? |
| A: CAS number of 4,6-Dichloro-3-cyclobutyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine is 2093978-87-9. |
| Q: What is the molecular weight of 4,6-Dichloro-3-cyclobutyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine? |
| A: Molecular weight of 4,6-Dichloro-3-cyclobutyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine is 318.2. |