N-[2-(3,3-dimethylpiperidin-1-yl)ethyl]prop-2-enamide
Modify Date: 2025-08-27 15:14:33
![N-[2-(3,3-dimethylpiperidin-1-yl)ethyl]prop-2-enamide Structure](https://www.chemsrc.com/extcaspic/159/2094391-87-2.png)
N-[2-(3,3-dimethylpiperidin-1-yl)ethyl]prop-2-enamide structure
|
Common Name | N-[2-(3,3-dimethylpiperidin-1-yl)ethyl]prop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 2094391-87-2 | Molecular Weight | 210.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H22N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[2-(3,3-dimethylpiperidin-1-yl)ethyl]prop-2-enamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H22N2O |
|---|---|
| Molecular Weight | 210.32 |
| InChIKey | UFGCUXQIAYSZRF-UHFFFAOYSA-N |
| SMILES | C=CC(=O)NCCN1CCCC(C)(C)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N-[2-(3,3-dimethylpiperidin-1-yl)ethyl]prop-2-enamide? |
| A: SMILES notation of N-[2-(3,3-dimethylpiperidin-1-yl)ethyl]prop-2-enamide is C=CC(=O)NCCN1CCCC(C)(C)C1. |
| Q: What is the molecular weight of N-[2-(3,3-dimethylpiperidin-1-yl)ethyl]prop-2-enamide? |
| A: Molecular weight of N-[2-(3,3-dimethylpiperidin-1-yl)ethyl]prop-2-enamide is 210.32. |
| Q: What is the Chinese name of 2094391-87-2? |
| A: Chinese name of 2094391-87-2 is 2094391-87-2. |
| Q: What is the InChIKey of N-[2-(3,3-dimethylpiperidin-1-yl)ethyl]prop-2-enamide? |
| A: InChIKey of N-[2-(3,3-dimethylpiperidin-1-yl)ethyl]prop-2-enamide is UFGCUXQIAYSZRF-UHFFFAOYSA-N. |
| Q: What is the CAS number of N-[2-(3,3-dimethylpiperidin-1-yl)ethyl]prop-2-enamide? |
| A: CAS number of N-[2-(3,3-dimethylpiperidin-1-yl)ethyl]prop-2-enamide is 2094391-87-2. |
| Q: What is the molecular formula of N-[2-(3,3-dimethylpiperidin-1-yl)ethyl]prop-2-enamide? |
| A: Molecular formula of N-[2-(3,3-dimethylpiperidin-1-yl)ethyl]prop-2-enamide is C12H22N2O. |
| Q: What is the English name of N-[2-(3,3-dimethylpiperidin-1-yl)ethyl]prop-2-enamide? |
| A: The English name of N-[2-(3,3-dimethylpiperidin-1-yl)ethyl]prop-2-enamide is N-[2-(3,3-dimethylpiperidin-1-yl)ethyl]prop-2-enamide. |