N-{1-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]ethyl}but-2-ynamide
Modify Date: 2026-07-01 15:46:31
![N-{1-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]ethyl}but-2-ynamide Structure](https://www.chemsrc.com/extcaspic/306/2094635-35-3.png)
N-{1-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]ethyl}but-2-ynamide structure
|
Common Name | N-{1-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]ethyl}but-2-ynamide | ||
|---|---|---|---|---|
| CAS Number | 2094635-35-3 | Molecular Weight | 334.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12BrN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-{1-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]ethyl}but-2-ynamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H12BrN3O2 |
|---|---|
| Molecular Weight | 334.17 |
| InChIKey | LRCJYUXOJUUMOQ-UHFFFAOYSA-N |
| SMILES | CC#CC(=O)NC(C)c1nc(-c2ccc(Br)cc2)no1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-{1-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]ethyl}but-2-ynamide? |
| A: CAS number of N-{1-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]ethyl}but-2-ynamide is 2094635-35-3. |
| Q: What is the molecular weight of N-{1-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]ethyl}but-2-ynamide? |
| A: Molecular weight of N-{1-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]ethyl}but-2-ynamide is 334.17. |
| Q: What is the InChIKey of N-{1-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]ethyl}but-2-ynamide? |
| A: InChIKey of N-{1-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]ethyl}but-2-ynamide is LRCJYUXOJUUMOQ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N-{1-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]ethyl}but-2-ynamide? |
| A: Molecular formula of N-{1-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]ethyl}but-2-ynamide is C14H12BrN3O2. |
| Q: What is the English name of N-{1-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]ethyl}but-2-ynamide? |
| A: The English name of N-{1-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]ethyl}but-2-ynamide is N-{1-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]ethyl}but-2-ynamide. |
| Q: What is the Chinese name of 2094635-35-3? |
| A: Chinese name of 2094635-35-3 is 2094635-35-3. |
| Q: What is the SMILES notation of N-{1-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]ethyl}but-2-ynamide? |
| A: SMILES notation of N-{1-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]ethyl}but-2-ynamide is CC#CC(=O)NC(C)c1nc(-c2ccc(Br)cc2)no1. |