N1-{3-[methyl(prop-2-yn-1-yl)amino]propyl}benzene-1,4-dicarboxamide
Modify Date: 2026-07-17 18:40:48
![N1-{3-[methyl(prop-2-yn-1-yl)amino]propyl}benzene-1,4-dicarboxamide Structure](https://www.chemsrc.com/extcaspic/471/2094824-93-6.png)
N1-{3-[methyl(prop-2-yn-1-yl)amino]propyl}benzene-1,4-dicarboxamide structure
|
Common Name | N1-{3-[methyl(prop-2-yn-1-yl)amino]propyl}benzene-1,4-dicarboxamide | ||
|---|---|---|---|---|
| CAS Number | 2094824-93-6 | Molecular Weight | 273.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H19N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N1-{3-[methyl(prop-2-yn-1-yl)amino]propyl}benzene-1,4-dicarboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H19N3O2 |
|---|---|
| Molecular Weight | 273.33 |
| InChIKey | ZXQXGKYPMQRRLZ-UHFFFAOYSA-N |
| SMILES | C#CCN(C)CCCNC(=O)c1ccc(C(N)=O)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of N1-{3-[methyl(prop-2-yn-1-yl)amino]propyl}benzene-1,4-dicarboxamide? |
| A: InChIKey of N1-{3-[methyl(prop-2-yn-1-yl)amino]propyl}benzene-1,4-dicarboxamide is ZXQXGKYPMQRRLZ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N1-{3-[methyl(prop-2-yn-1-yl)amino]propyl}benzene-1,4-dicarboxamide? |
| A: Molecular formula of N1-{3-[methyl(prop-2-yn-1-yl)amino]propyl}benzene-1,4-dicarboxamide is C15H19N3O2. |
| Q: What is the CAS number of N1-{3-[methyl(prop-2-yn-1-yl)amino]propyl}benzene-1,4-dicarboxamide? |
| A: CAS number of N1-{3-[methyl(prop-2-yn-1-yl)amino]propyl}benzene-1,4-dicarboxamide is 2094824-93-6. |
| Q: What is the molecular weight of N1-{3-[methyl(prop-2-yn-1-yl)amino]propyl}benzene-1,4-dicarboxamide? |
| A: Molecular weight of N1-{3-[methyl(prop-2-yn-1-yl)amino]propyl}benzene-1,4-dicarboxamide is 273.33. |
| Q: What is the Chinese name of 2094824-93-6? |
| A: Chinese name of 2094824-93-6 is 2094824-93-6. |
| Q: What is the SMILES notation of N1-{3-[methyl(prop-2-yn-1-yl)amino]propyl}benzene-1,4-dicarboxamide? |
| A: SMILES notation of N1-{3-[methyl(prop-2-yn-1-yl)amino]propyl}benzene-1,4-dicarboxamide is C#CCN(C)CCCNC(=O)c1ccc(C(N)=O)cc1. |
| Q: What is the English name of N1-{3-[methyl(prop-2-yn-1-yl)amino]propyl}benzene-1,4-dicarboxamide? |
| A: The English name of N1-{3-[methyl(prop-2-yn-1-yl)amino]propyl}benzene-1,4-dicarboxamide is N1-{3-[methyl(prop-2-yn-1-yl)amino]propyl}benzene-1,4-dicarboxamide. |