2-{bicyclo[2.2.1]heptan-2-yl}-N-(4-cyanothian-4-yl)acetamide
Modify Date: 2026-09-27 10:42:08
![2-{bicyclo[2.2.1]heptan-2-yl}-N-(4-cyanothian-4-yl)acetamide Structure](https://www.chemsrc.com/extcaspic/171/2094939-07-6.png)
2-{bicyclo[2.2.1]heptan-2-yl}-N-(4-cyanothian-4-yl)acetamide structure
|
Common Name | 2-{bicyclo[2.2.1]heptan-2-yl}-N-(4-cyanothian-4-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 2094939-07-6 | Molecular Weight | 278.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H22N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-{bicyclo[2.2.1]heptan-2-yl}-N-(4-cyanothian-4-yl)acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H22N2OS |
|---|---|
| Molecular Weight | 278.4 |
| InChIKey | ZQGNIQXJPHHUPE-UHFFFAOYSA-N |
| SMILES | N#CC1(NC(=O)CC2CC3CCC2C3)CCSCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2094939-07-6? |
| A: Chinese name of 2094939-07-6 is 2094939-07-6. |
| Q: What is the molecular weight of 2-{bicyclo[2.2.1]heptan-2-yl}-N-(4-cyanothian-4-yl)acetamide? |
| A: Molecular weight of 2-{bicyclo[2.2.1]heptan-2-yl}-N-(4-cyanothian-4-yl)acetamide is 278.4. |
| Q: What is the SMILES notation of 2-{bicyclo[2.2.1]heptan-2-yl}-N-(4-cyanothian-4-yl)acetamide? |
| A: SMILES notation of 2-{bicyclo[2.2.1]heptan-2-yl}-N-(4-cyanothian-4-yl)acetamide is N#CC1(NC(=O)CC2CC3CCC2C3)CCSCC1. |
| Q: What is the molecular formula of 2-{bicyclo[2.2.1]heptan-2-yl}-N-(4-cyanothian-4-yl)acetamide? |
| A: Molecular formula of 2-{bicyclo[2.2.1]heptan-2-yl}-N-(4-cyanothian-4-yl)acetamide is C15H22N2OS. |
| Q: What is the English name of 2-{bicyclo[2.2.1]heptan-2-yl}-N-(4-cyanothian-4-yl)acetamide? |
| A: The English name of 2-{bicyclo[2.2.1]heptan-2-yl}-N-(4-cyanothian-4-yl)acetamide is 2-{bicyclo[2.2.1]heptan-2-yl}-N-(4-cyanothian-4-yl)acetamide. |
| Q: What is the CAS number of 2-{bicyclo[2.2.1]heptan-2-yl}-N-(4-cyanothian-4-yl)acetamide? |
| A: CAS number of 2-{bicyclo[2.2.1]heptan-2-yl}-N-(4-cyanothian-4-yl)acetamide is 2094939-07-6. |
| Q: What is the InChIKey of 2-{bicyclo[2.2.1]heptan-2-yl}-N-(4-cyanothian-4-yl)acetamide? |
| A: InChIKey of 2-{bicyclo[2.2.1]heptan-2-yl}-N-(4-cyanothian-4-yl)acetamide is ZQGNIQXJPHHUPE-UHFFFAOYSA-N. |