3-Bromo-5-(3-methyl-4H-1,2,4-triazol-4-YL)benzoic acid
Modify Date: 2025-09-09 13:08:57
3-Bromo-5-(3-methyl-4H-1,2,4-triazol-4-YL)benzoic acid structure
|
Common Name | 3-Bromo-5-(3-methyl-4H-1,2,4-triazol-4-YL)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 2095060-18-5 | Molecular Weight | 282.09 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8BrN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Bromo-5-(3-methyl-4H-1,2,4-triazol-4-YL)benzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H8BrN3O2 |
|---|---|
| Molecular Weight | 282.09 |
| InChIKey | WJAFXVMGTFCYAS-UHFFFAOYSA-N |
| SMILES | Cc1nncn1-c1cc(Br)cc(C(=O)O)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-Bromo-5-(3-methyl-4H-1,2,4-triazol-4-YL)benzoic acid? |
| A: InChIKey of 3-Bromo-5-(3-methyl-4H-1,2,4-triazol-4-YL)benzoic acid is WJAFXVMGTFCYAS-UHFFFAOYSA-N. |
| Q: What is the English name of 3-Bromo-5-(3-methyl-4H-1,2,4-triazol-4-YL)benzoic acid? |
| A: The English name of 3-Bromo-5-(3-methyl-4H-1,2,4-triazol-4-YL)benzoic acid is 3-Bromo-5-(3-methyl-4H-1,2,4-triazol-4-YL)benzoic acid. |
| Q: What is the molecular formula of 3-Bromo-5-(3-methyl-4H-1,2,4-triazol-4-YL)benzoic acid? |
| A: Molecular formula of 3-Bromo-5-(3-methyl-4H-1,2,4-triazol-4-YL)benzoic acid is C10H8BrN3O2. |
| Q: What is the SMILES notation of 3-Bromo-5-(3-methyl-4H-1,2,4-triazol-4-YL)benzoic acid? |
| A: SMILES notation of 3-Bromo-5-(3-methyl-4H-1,2,4-triazol-4-YL)benzoic acid is Cc1nncn1-c1cc(Br)cc(C(=O)O)c1. |
| Q: What is the molecular weight of 3-Bromo-5-(3-methyl-4H-1,2,4-triazol-4-YL)benzoic acid? |
| A: Molecular weight of 3-Bromo-5-(3-methyl-4H-1,2,4-triazol-4-YL)benzoic acid is 282.09. |
| Q: What is the Chinese name of 2095060-18-5? |
| A: Chinese name of 2095060-18-5 is 2095060-18-5. |
| Q: What is the CAS number of 3-Bromo-5-(3-methyl-4H-1,2,4-triazol-4-YL)benzoic acid? |
| A: CAS number of 3-Bromo-5-(3-methyl-4H-1,2,4-triazol-4-YL)benzoic acid is 2095060-18-5. |