6-Bromo-4-chloro-3-methyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine
Modify Date: 2026-07-06 16:59:46
![6-Bromo-4-chloro-3-methyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine Structure](https://www.chemsrc.com/extcaspic/226/2095097-64-4.png)
6-Bromo-4-chloro-3-methyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine structure
|
Common Name | 6-Bromo-4-chloro-3-methyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine | ||
|---|---|---|---|---|
| CAS Number | 2095097-64-4 | Molecular Weight | 322.59 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9BrClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-Bromo-4-chloro-3-methyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H9BrClN3 |
|---|---|
| Molecular Weight | 322.59 |
| InChIKey | DKQFXUILXSYSHX-UHFFFAOYSA-N |
| SMILES | Cc1nn(-c2ccccc2)c2nc(Br)cc(Cl)c12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 6-Bromo-4-chloro-3-methyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine? |
| A: SMILES notation of 6-Bromo-4-chloro-3-methyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine is Cc1nn(-c2ccccc2)c2nc(Br)cc(Cl)c12. |
| Q: What is the molecular weight of 6-Bromo-4-chloro-3-methyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine? |
| A: Molecular weight of 6-Bromo-4-chloro-3-methyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine is 322.59. |
| Q: What is the molecular formula of 6-Bromo-4-chloro-3-methyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine? |
| A: Molecular formula of 6-Bromo-4-chloro-3-methyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine is C13H9BrClN3. |
| Q: What is the Chinese name of 2095097-64-4? |
| A: Chinese name of 2095097-64-4 is 2095097-64-4. |
| Q: What is the English name of 6-Bromo-4-chloro-3-methyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine? |
| A: The English name of 6-Bromo-4-chloro-3-methyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine is 6-Bromo-4-chloro-3-methyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine. |
| Q: What is the CAS number of 6-Bromo-4-chloro-3-methyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine? |
| A: CAS number of 6-Bromo-4-chloro-3-methyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine is 2095097-64-4. |
| Q: What is the InChIKey of 6-Bromo-4-chloro-3-methyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine? |
| A: InChIKey of 6-Bromo-4-chloro-3-methyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine is DKQFXUILXSYSHX-UHFFFAOYSA-N. |