2,6-diiodo-4-methylsulfonylphenol structure
|
Common Name | 2,6-diiodo-4-methylsulfonylphenol | ||
|---|---|---|---|---|
| CAS Number | 20951-03-5 | Molecular Weight | 423.99500 | |
| Density | 2.439 g/cm3 | Boiling Point | 401.7ºC at 760 mmHg | |
| Molecular Formula | C7H6I2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.7ºC | |
| Name | 2,6-diiodo-4-methylsulfonylphenol |
|---|
| Density | 2.439 g/cm3 |
|---|---|
| Boiling Point | 401.7ºC at 760 mmHg |
| Molecular Formula | C7H6I2O3S |
| Molecular Weight | 423.99500 |
| Flash Point | 196.7ºC |
| Exact Mass | 423.81300 |
| PSA | 62.75000 |
| LogP | 3.08570 |
| Vapour Pressure | 5E-07mmHg at 25°C |
| Index of Refraction | 1.705 |
| InChIKey | FTIFVUFZYLYABI-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1cc(I)c(O)c(I)c1 |
| HS Code | 2908999090 |
|---|
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |