p-[3-[2-(Dimethylamino)ethoxy]-1H-indazol-1-yl]benzoic acid butyl ester structure
|
Common Name | p-[3-[2-(Dimethylamino)ethoxy]-1H-indazol-1-yl]benzoic acid butyl ester | ||
|---|---|---|---|---|
| CAS Number | 20954-12-5 | Molecular Weight | 381.46800 | |
| Density | 1.13g/cm3 | Boiling Point | 474.5ºC at 760 mmHg | |
| Molecular Formula | C22H27N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.8ºC | |
| Name | butyl 4-[3-[2-(dimethylamino)ethoxy]indazol-1-yl]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 474.5ºC at 760 mmHg |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.46800 |
| Flash Point | 240.8ºC |
| Exact Mass | 381.20500 |
| PSA | 56.59000 |
| LogP | 3.92280 |
| Vapour Pressure | 3.6E-09mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | VZXXAZKSJMKSPJ-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)c1ccc(-n2nc(OCCN(C)C)c3ccccc32)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-[3-(2-dimethylamino-ethoxy)-indazol-1-yl]-benzoic acid butyl ester |
| ITF 631 |
| butyl 4-[3-(2-dimethylaminoethyloxy)indazol-1-yl]benzoate |
| p-(3-(2-(Dimethylamino)ethoxy)-1H-indazol-1-yl)benzoic acid butyl ester |
| BENZOIC ACID,p-(3-(2-(DIMETHYLAMINO)ETHOXY)-1H-INDAZOL-1-YL)-,BUTYL ESTER |