p-[3-[3-(Dimethylamino)propoxy]-1H-indazol-1-yl]benzoic acid butyl ester structure
|
Common Name | p-[3-[3-(Dimethylamino)propoxy]-1H-indazol-1-yl]benzoic acid butyl ester | ||
|---|---|---|---|---|
| CAS Number | 20954-15-8 | Molecular Weight | 395.49500 | |
| Density | 1.12g/cm3 | Boiling Point | 492.1ºC at 760 mmHg | |
| Molecular Formula | C23H29N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.4ºC | |
| Name | butyl 4-[3-[3-(dimethylamino)propoxy]indazol-1-yl]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 492.1ºC at 760 mmHg |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.49500 |
| Flash Point | 251.4ºC |
| Exact Mass | 395.22100 |
| PSA | 56.59000 |
| LogP | 4.31290 |
| Vapour Pressure | 7.88E-10mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | ZNHBGQCKVQVSPG-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)c1ccc(-n2nc(OCCCN(C)C)c3ccccc32)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ITF 633 |
| 4-[3-(3-dimethylamino-propoxy)-indazol-1-yl]-benzoic acid butyl ester |
| p-[3-[3-(Dimethylamino)propoxy]-1H-indazol-1-yl]benzoic acid butyl ester |
| BENZOIC ACID,p-(3-(3-(DIMETHYLAMINO)PROPOXY)-1H-INDAZOL-1-YL)-,BUTYL ESTER |