CID 129052435
Modify Date: 2026-08-02 18:44:58
CID 129052435 structure
|
Common Name | CID 129052435 | ||
|---|---|---|---|---|
| CAS Number | 2095671-26-2 | Molecular Weight | 312.39 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | CID 129052435 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H20N2O4S |
|---|---|
| Molecular Weight | 312.39 |
| InChIKey | JGIAZWZHFJYYCY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1csc(C2CN(C(=O)OC(C)(C)C)C2)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of CID 129052435? |
| A: InChIKey of CID 129052435 is JGIAZWZHFJYYCY-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of CID 129052435? |
| A: SMILES notation of CID 129052435 is CCOC(=O)c1csc(C2CN(C(=O)OC(C)(C)C)C2)n1. |
| Q: What is the CAS number of CID 129052435? |
| A: CAS number of CID 129052435 is 2095671-26-2. |
| Q: What is the Chinese name of 2095671-26-2? |
| A: Chinese name of 2095671-26-2 is 2095671-26-2. |
| Q: What is the molecular formula of CID 129052435? |
| A: Molecular formula of CID 129052435 is C14H20N2O4S. |
| Q: What is the molecular weight of CID 129052435? |
| A: Molecular weight of CID 129052435 is 312.39. |
| Q: What is the English name of CID 129052435? |
| A: The English name of CID 129052435 is CID 129052435. |