N,N-dimethyl-3-{4-[(1-tetrahydro-2H-pyran-4-yl-4-piperidyl)methyl]phenyl}propanamide structure
|
Common Name | N,N-dimethyl-3-{4-[(1-tetrahydro-2H-pyran-4-yl-4-piperidyl)methyl]phenyl}propanamide | ||
|---|---|---|---|---|
| CAS Number | 2096110-85-7 | Molecular Weight | 358.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H34N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N,N-dimethyl-3-{4-[(1-tetrahydro-2H-pyran-4-yl-4-piperidyl)methyl]phenyl}propanamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H34N2O2 |
|---|---|
| Molecular Weight | 358.5 |
| InChIKey | VTVMFUUXFORMSK-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)CCc1ccc(CC2CCN(C3CCOCC3)CC2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of N,N-dimethyl-3-{4-[(1-tetrahydro-2H-pyran-4-yl-4-piperidyl)methyl]phenyl}propanamide? |
| A: InChIKey of N,N-dimethyl-3-{4-[(1-tetrahydro-2H-pyran-4-yl-4-piperidyl)methyl]phenyl}propanamide is VTVMFUUXFORMSK-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N,N-dimethyl-3-{4-[(1-tetrahydro-2H-pyran-4-yl-4-piperidyl)methyl]phenyl}propanamide? |
| A: SMILES notation of N,N-dimethyl-3-{4-[(1-tetrahydro-2H-pyran-4-yl-4-piperidyl)methyl]phenyl}propanamide is CN(C)C(=O)CCc1ccc(CC2CCN(C3CCOCC3)CC2)cc1. |
| Q: What is the English name of N,N-dimethyl-3-{4-[(1-tetrahydro-2H-pyran-4-yl-4-piperidyl)methyl]phenyl}propanamide? |
| A: The English name of N,N-dimethyl-3-{4-[(1-tetrahydro-2H-pyran-4-yl-4-piperidyl)methyl]phenyl}propanamide is N,N-dimethyl-3-{4-[(1-tetrahydro-2H-pyran-4-yl-4-piperidyl)methyl]phenyl}propanamide. |
| Q: What is the molecular weight of N,N-dimethyl-3-{4-[(1-tetrahydro-2H-pyran-4-yl-4-piperidyl)methyl]phenyl}propanamide? |
| A: Molecular weight of N,N-dimethyl-3-{4-[(1-tetrahydro-2H-pyran-4-yl-4-piperidyl)methyl]phenyl}propanamide is 358.5. |
| Q: What is the molecular formula of N,N-dimethyl-3-{4-[(1-tetrahydro-2H-pyran-4-yl-4-piperidyl)methyl]phenyl}propanamide? |
| A: Molecular formula of N,N-dimethyl-3-{4-[(1-tetrahydro-2H-pyran-4-yl-4-piperidyl)methyl]phenyl}propanamide is C22H34N2O2. |
| Q: What is the CAS number of N,N-dimethyl-3-{4-[(1-tetrahydro-2H-pyran-4-yl-4-piperidyl)methyl]phenyl}propanamide? |
| A: CAS number of N,N-dimethyl-3-{4-[(1-tetrahydro-2H-pyran-4-yl-4-piperidyl)methyl]phenyl}propanamide is 2096110-85-7. |
| Q: What is the Chinese name of 2096110-85-7? |
| A: Chinese name of 2096110-85-7 is 2096110-85-7. |